You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Bovine Metabolome Database.
Record Information
Version1.0
Creation Date2016-09-30 22:45:44 UTC
Update Date2020-05-21 16:29:07 UTC
BMDB IDBMDB0001423
Secondary Accession Numbers
  • BMDB01423
Metabolite Identification
Common NameCoenzyme A
DescriptionCoenzyme A, also known as CoA or coenzyme A-SH, belongs to the class of organic compounds known as coenzyme a and derivatives. These are derivative of vitamin B5 containing a 4'-phosphopantetheine moiety attached to a diphospho-adenosine. Coenzyme A is a strong basic compound (based on its pKa). Coenzyme A exists in all living species, ranging from bacteria to humans.
Structure
Thumb
Synonyms
ValueSource
3'-Phosphoadenosine-(5')diphospho(4')pantatheineChEBI
[(2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]methyl (3R)-3-hydroxy-4-({3-oxo-3-[(2-sulfanylethyl)amino]propyl}amino)-2,2-dimethyl-4-oxobutyl dihydrogen diphosphateChEBI
CoAChEBI
CoA-SHChEBI
CoASHChEBI
Coenzym aChEBI
HSCoAChEBI
Koenzym aChEBI
[(2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]methyl (3R)-3-hydroxy-4-({3-oxo-3-[(2-sulfanylethyl)amino]propyl}amino)-2,2-dimethyl-4-oxobutyl dihydrogen diphosphoric acidGenerator
[(2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]methyl (3R)-3-hydroxy-4-({3-oxo-3-[(2-sulphanylethyl)amino]propyl}amino)-2,2-dimethyl-4-oxobutyl dihydrogen diphosphateGenerator
[(2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]methyl (3R)-3-hydroxy-4-({3-oxo-3-[(2-sulphanylethyl)amino]propyl}amino)-2,2-dimethyl-4-oxobutyl dihydrogen diphosphoric acidGenerator
a, CoenzymeHMDB
18-CoA-18-oxo-Dinor-LTB4HMDB
Acetoacetyl coenzyme A sodium saltHMDB
CoA HydrateHMDB
coenzyme A HydrateHMDB
coenzyme A-SHHMDB
coenzyme ASHHMDB
Depot-zeelHMDB
Propionyl CoAHMDB
Propionyl coenzyme AHMDB
S-PropanoateHMDB
S-Propanoate CoAHMDB
S-Propanoate coenzyme AHMDB
S-Propanoic acidHMDB
S-Propionate CoAHMDB
S-Propionate coenzyme AHMDB
ZeelHMDB
Coenzyme AHMDB
Chemical FormulaC21H36N7O16P3S
Average Molecular Weight767.534
Monoisotopic Molecular Weight767.115208365
IUPAC Name{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({hydroxy[(3R)-3-hydroxy-2,2-dimethyl-3-({2-[(2-sulfanylethyl)carbamoyl]ethyl}carbamoyl)propoxy]phosphoryl}oxy)phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid
Traditional Namecoenzyme A
CAS Registry Number85-61-0
SMILES
CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)N1C=NC2=C1N=CN=C2N)[C@@H](O)C(=O)NCCC(=O)NCCS
InChI Identifier
InChI=1S/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16+,20-/m1/s1
InChI KeyRGJOEKWQDUBAIZ-IBOSZNHHSA-N
Chemical Taxonomy
Description belongs to the class of organic compounds known as coenzyme a and derivatives. These are derivative of vitamin B5 containing a 4'-phosphopantetheine moiety attached to a diphospho-adenosine.
KingdomOrganic compounds
Super ClassNucleosides, nucleotides, and analogues
ClassPurine nucleotides
Sub ClassPurine ribonucleotides
Direct ParentCoenzyme A and derivatives
Alternative Parents
Substituents
  • Coenzyme a or derivatives
  • Purine ribonucleoside diphosphate
  • Pentose phosphate
  • Pentose-5-phosphate
  • Ribonucleoside 3'-phosphate
  • Glycosyl compound
  • N-glycosyl compound
  • Organic pyrophosphate
  • Pentose monosaccharide
  • Monosaccharide phosphate
  • 6-aminopurine
  • Purine
  • Imidazopyrimidine
  • Aminopyrimidine
  • Monoalkyl phosphate
  • Organic phosphoric acid derivative
  • N-substituted imidazole
  • Phosphoric acid ester
  • Monosaccharide
  • Alkyl phosphate
  • Pyrimidine
  • Imidolactam
  • Imidazole
  • Azole
  • Heteroaromatic compound
  • Tetrahydrofuran
  • Secondary alcohol
  • Oxacycle
  • Alkylthiol
  • Azacycle
  • Organoheterocyclic compound
  • Carboximidic acid
  • Carboximidic acid derivative
  • Organic 1,3-dipolar compound
  • Propargyl-type 1,3-dipolar organic compound
  • Organooxygen compound
  • Alcohol
  • Hydrocarbon derivative
  • Organic nitrogen compound
  • Organic oxide
  • Primary amine
  • Organopnictogen compound
  • Organic oxygen compound
  • Amine
  • Organosulfur compound
  • Organonitrogen compound
  • Aromatic heteropolycyclic compound
Molecular FrameworkAromatic heteropolycyclic compounds
External Descriptors
Ontology
StatusDetected but not Quantified
Origin
  • Endogenous
BiofunctionNot Available
ApplicationNot Available
Cellular locations
  • Cytoplasm
  • Endoplasmic reticulum
  • Golgi
  • Lysosome
  • Mitochondria
  • Nucleus
  • Peroxisome
Physical Properties
StateSolid
Experimental Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Predicted Properties
PropertyValueSource
logP-0.61ALOGPS
logP-5.7ChemAxon
logS-2.2ALOGPS
pKa (Strongest Acidic)0.82ChemAxon
pKa (Strongest Basic)4.01ChemAxon
Physiological Charge-4ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count10ChemAxon
Polar Surface Area346.56 ŲChemAxon
Rotatable Bond Count18ChemAxon
Refractivity162.74 m³·mol⁻¹ChemAxon
Polarizability65.36 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Spectra
Spectra
Spectrum TypeDescriptionSplash Key
Predicted GC-MSPredicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positivesplash10-0002-9423572000-e15b71f4fd7a2baa5a35View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 10V, Positive (Annotated)splash10-014i-0000000900-7edeffc9e7f47049c6afView in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 25V, Positive (Annotated)splash10-03di-0090200000-1bf2c11b25a8c3f528a7View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 40V, Positive (Annotated)splash10-03di-0490000000-b4270769e635660752ddView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Positivesplash10-002s-5900000100-c920e6430f49f066a644View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Positivesplash10-002r-6910000000-4dcac54e50dd5309af5cView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Positivesplash10-002r-8900000000-c9fc1dcc0fa2fecbf2f0View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Negativesplash10-001i-6910232700-7e01b474d15249f13f3eView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Negativesplash10-001i-2900200000-23c6af6438be416c3b4eView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Negativesplash10-057i-6900100000-a9a1d2f2162117f6ad81View in MoNA
1D NMR1H NMR SpectrumNot AvailableView in JSpectraViewer
2D NMR[1H,13C] 2D NMR SpectrumNot AvailableView in JSpectraViewer
Biological Properties
Cellular Locations
  • Cytoplasm
  • Endoplasmic reticulum
  • Golgi
  • Lysosome
  • Mitochondria
  • Nucleus
  • Peroxisome
Biospecimen Locations
  • Adipose Tissue
  • Fibroblasts
  • Liver
  • Skeletal Muscle
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
Adipose TissueExpected but not QuantifiedNot ApplicableNot SpecifiedNot SpecifiedNormal
  • Not Applicable
details
FibroblastsExpected but not QuantifiedNot ApplicableNot SpecifiedNot SpecifiedNormal
  • Not Applicable
details
LiverDetected but not QuantifiedNot ApplicableNot SpecifiedNot Specified
Normal
details
Skeletal MuscleExpected but not QuantifiedNot ApplicableNot SpecifiedNot SpecifiedNormal
  • Not Applicable
details
Abnormal Concentrations
Not Available
HMDB IDHMDB0001423
DrugBank IDDB01992
Phenol Explorer Compound IDNot Available
FooDB IDFDB022614
KNApSAcK IDC00007258
Chemspider IDNot Available
KEGG Compound IDC00010
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkCoenzyme_A
METLIN IDNot Available
PubChem Compound87642
PDB IDNot Available
ChEBI ID15346
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General ReferencesNot Available

Enzymes

General function:
Energy production and conversion
Specific function:
Catalyzes the cleavage of citrate into oxaloacetate and acetyl-CoA, the latter serving as common substrate for de novo cholesterol and fatty acid synthesis.
Gene Name:
ACLY
Uniprot ID:
Q32PF2
Molecular weight:
119789.0
Reactions
Coenzyme A + Citric acid + Adenosine triphosphate → Oxalacetic acid + ADP + Acetyl-CoAdetails
General function:
Lipid transport and metabolism
Specific function:
Not Available
Gene Name:
GNPAT
Uniprot ID:
A4IF87
Molecular weight:
77664.0
Reactions
Glycerol 3-phosphate + Long-chain fatty acyl-CoA → 1-Acyl-sn-glycerol 3-phosphate + Coenzyme Adetails
Palmityl-CoA + Glycerol 3-phosphate → Coenzyme A + LPA(16:0/0:0)details
Stearoyl-CoA + Glycerol 3-phosphate → Coenzyme A + LPA(18:0/0:0)details
Oleoyl-CoA + Glycerol 3-phosphate → Coenzyme A + LysoPA(18:1(9Z)/0:0)details
Gamma-linolenoyl-CoA + Glycerol 3-phosphate → Coenzyme A + LysoPA(18:3(6Z,9Z,12Z)/0:0)details
Eicosanoyl-CoA + Glycerol 3-phosphate → Coenzyme A + LysoPA(20:0/0:0)details
Gondoyl-CoA + Glycerol 3-phosphate → Coenzyme A + LysoPA(20:1(11Z)/0:0)details
Docosanoyl-CoA + Glycerol 3-phosphate → Coenzyme A + LysoPA(22:0/0:0)details
Erucoyl-CoA + Glycerol 3-phosphate → Coenzyme A + LysoPA(22:1(13Z)/0:0)details
Eicosanoyl-CoA + Dihydroxyacetone phosphate → DHAP(18:0) + Coenzyme Adetails
General function:
Involved in carnitine O-octanoyltransferase activity
Specific function:
Beta-oxidation of fatty acids. The highest activity concerns the C6 to C10 chain length substrate.
Gene Name:
CROT
Uniprot ID:
O19094
Molecular weight:
70263.0
Reactions
Acetyl-CoA + L-Carnitine → L-Acetylcarnitine + Coenzyme Adetails
Lauroyl-CoA → Coenzyme A + Dodecanoic aciddetails
L-Acetylcarnitine + L-Carnitine → Acetyl-CoA + Coenzyme Adetails
General function:
Involved in carnitine O-palmitoyltransferase activity
Specific function:
Not Available
Gene Name:
CPT1B
Uniprot ID:
Q58DK1
Molecular weight:
88512.0
Reactions
Palmityl-CoA + L-Carnitine → L-Palmitoylcarnitine + Coenzyme Adetails
Stearoyl-CoA + L-Carnitine → Stearoylcarnitine + Coenzyme Adetails
General function:
Involved in carnitine O-palmitoyltransferase activity
Specific function:
Not Available
Gene Name:
CPT2
Uniprot ID:
Q2KJB7
Molecular weight:
74483.0
Reactions
4,8-Dimethylnonanoyl-CoA + L-Carnitine → 4,8 dimethylnonanoyl carnitine + Coenzyme Adetails
Dodecanoic acid + Coenzyme A → Lauroyl-CoA + L-Carnitinedetails
Palmityl-CoA + L-Carnitine → L-Palmitoylcarnitine + Coenzyme Adetails
Stearoyl-CoA + L-Carnitine → Stearoylcarnitine + Coenzyme Adetails
General function:
Energy production and conversion
Specific function:
Plays a role in valine and pyrimidine metabolism. Binds fatty acyl-CoA.
Gene Name:
ALDH6A1
Uniprot ID:
Q07536
Molecular weight:
58063.0
Reactions
Malonic semialdehyde + Coenzyme A + NAD → Acetyl-CoA + Carbon dioxide + NADHdetails
(S)-Methylmalonic acid semialdehyde + Water + NAD + Coenzyme A → Propionyl-CoA + NADH + Hydrogen carbonatedetails
General function:
Transcription
Specific function:
Controls the night/day rhythm of melatonin production in the pineal gland. Catalyzes the N-acetylation of serotonin into N-acetylserotonin, the penultimate step in the synthesis of melatonin.
Gene Name:
AANAT
Uniprot ID:
O02785
Molecular weight:
22997.0
Reactions
Serotonin + Acetyl-CoA → N-Acetylserotonin + Coenzyme Adetails
General function:
Lipid transport and metabolism
Specific function:
This enzyme condenses acetyl-CoA with acetoacetyl-CoA to form HMG-CoA, which is the substrate for HMG-CoA reductase.
Gene Name:
HMGCS2
Uniprot ID:
Q2KIE6
Molecular weight:
56895.0
Reactions
Acetyl-CoA + Acetoacetyl-CoA + Water → 3-Hydroxy-3-methylglutaryl-CoA + Coenzyme Adetails
General function:
Secondary metabolites biosynthesis, transport and catabolism
Specific function:
Participates in the detoxification of a plethora of hydrazine and arylamine drugs.
Gene Name:
NAT1
Uniprot ID:
Q1JPA6
Molecular weight:
34199.0
Reactions
Paraxanthine + Acetyl-CoA → 5-Acetylamino-6-formylamino-3-methyluracil + Coenzyme Adetails
General function:
Energy production and conversion
Specific function:
Not Available
Gene Name:
CS
Uniprot ID:
Q29RK1
Molecular weight:
51773.0
Reactions
Acetyl-CoA + Water + Oxalacetic acid → Citric acid + Coenzyme Adetails
General function:
Coenzyme transport and metabolism
Specific function:
Not Available
Gene Name:
GCAT
Uniprot ID:
Q0P5L8
Molecular weight:
45166.0
Reactions
Acetyl-CoA + Glycine → L-2-Amino-3-oxobutanoic acid + Coenzyme Adetails
General function:
Lipid transport and metabolism
Specific function:
Catalyzes the synthesis of acetyl-CoA from short-chain fatty acids (By similarity). Propionate is the preferred substrate but can also utilize acetate and butyrate with a much lower affinity.
Gene Name:
ACSS3
Uniprot ID:
A7MB45
Molecular weight:
74805.0
Reactions
Caproic acid + Adenosine triphosphate + Coenzyme A → Hexanoyl-CoA + Adenosine monophosphate + Pyrophosphatedetails
General function:
Secondary metabolites biosynthesis, transport and catabolism
Specific function:
Fatty acid synthetase catalyzes the formation of long-chain fatty acids from acetyl-CoA, malonyl-CoA and NADPH. This multifunctional protein has 7 catalytic activities as an acyl carrier protein.
Gene Name:
FASN
Uniprot ID:
Q71SP7
Molecular weight:
274554.0
Reactions
Acetyl-CoA → Acetic acid + Coenzyme Adetails
Malonyl-CoA → Malonic acid + Coenzyme Adetails
General function:
Lipid transport and metabolism
Specific function:
In the production of energy from fats, this is one of the enzymes that catalyzes the last step of the mitochondrial beta-oxidation pathway, an aerobic process breaking down fatty acids into acetyl-CoA. Using free coenzyme A/CoA, catalyzes the thiolytic cleavage of medium- to long-chain unbranched 3-oxoacyl-CoAs into acetyl-CoA and a fatty acyl-CoA shortened by two carbon atoms. Also catalyzes the condensation of two acetyl-CoA molecules into acetoacetyl-CoA and could be involved in the production of ketone bodies. Also displays hydrolase activity on various fatty acyl-CoAs (By similarity). Thereby, could be responsible for the production of acetate in a side reaction to beta-oxidation (By similarity). Abolishes BNIP3-mediated apoptosis and mitochondrial damage (By similarity).
Gene Name:
ACAA2
Uniprot ID:
Q3T0R7
Molecular weight:
42131.0
Reactions
Coenzyme A + Acetoacetyl-CoA →2 Acetyl-CoAdetails
2-Methylacetoacetyl-CoA + Coenzyme A → Propionyl-CoA + Acetyl-CoAdetails
General function:
Lipid transport and metabolism
Specific function:
This is one of the enzymes that catalyzes the last step of the mitochondrial beta-oxidation pathway, an aerobic process breaking down fatty acids into acetyl-CoA. Using free coenzyme A/CoA, catalyzes the thiolytic cleavage of medium- to long-chain 3-oxoacyl-CoAs into acetyl-CoA and a fatty acyl-CoA shortened by two carbon atoms. The activity of the enzyme is reversible and it can also catalyze the condensation of two acetyl-CoA molecules into acetoacetyl-CoA. Thereby, it plays a major role in ketone body metabolism.
Gene Name:
ACAT1
Uniprot ID:
Q29RZ0
Molecular weight:
44889.0
Reactions
2 Acetyl-CoA → Acetoacetyl-CoA + Coenzyme Adetails
Coenzyme A + Acetoacetyl-CoA →2 Acetyl-CoAdetails
General function:
Lipid transport and metabolism
Specific function:
Catalyzes the activation of fatty acids by CoA to produce an acyl-CoA, the first step in fatty acid metabolism (PubMed:11382754, PubMed:10561077). Capable of activating medium-chain fatty acids (e.g. butyric (C4) to decanoic (C10) acids), and certain carboxylate-containing xenobiotics, e.g. benzoate (PubMed:10561077, PubMed:11382754). Also catalyzes the activation of lipoate to lipoyl-nucleoside monophosphate (PubMed:11382754). Activates lipoate with GTP at a 1000-fold higher rate than with ATP and activates both (R)- and (S)-lipoate to the respective lipoyl-GMP, with a preference for (R)-lipoate (PubMed:11382754).
Gene Name:
ACSM1
Uniprot ID:
Q9BEA2
Molecular weight:
64923.0
Reactions
Dodecanoic acid + Adenosine triphosphate + Coenzyme A → Lauroyl-CoA + Adenosine monophosphate + Pyrophosphatedetails
General function:
Involved in diacylglycerol O-acyltransferase activity
Specific function:
Essential acyltransferase that catalyzes the terminal and only committed step in triacylglycerol synthesis by using diacylglycerol and fatty acyl CoA as substrates. Required for synthesis and storage of intracellular triglycerides. Probably plays a central role in cytosolic lipid accumulation. In liver, is primarily responsible for incorporating endogenously synthesized fatty acids into triglycerides. Functions also as an acyl-CoA retinol acyltransferase (ARAT) (By similarity).
Gene Name:
DGAT2
Uniprot ID:
Q70VZ8
Molecular weight:
40896.0
Reactions
11-cis-Retinol + Acetyl-CoA → Retinyl palmitate + Coenzyme Adetails
General function:
Lipid transport and metabolism
Specific function:
Hydrolyzes 3-hydroxyisobutyryl-CoA (HIBYL-CoA), a saline catabolite. Has high activity toward isobutyryl-CoA. Could be an isobutyryl-CoA dehydrogenase that functions in valine catabolism. Also hydrolyzes 3-hydroxypropanoyl-CoA (By similarity).
Gene Name:
HIBCH
Uniprot ID:
Q2HJ73
Molecular weight:
43349.0
Reactions
(S)-3-Hydroxyisobutyryl-CoA + Water → (S)-3-Hydroxyisobutyric acid + Coenzyme Adetails
3-Hydroxypropionyl-CoA + Water → Hydroxypropionic acid + Coenzyme Adetails
General function:
Coenzyme transport and metabolism
Specific function:
Not Available
Gene Name:
ALAS1
Uniprot ID:
A6QLI6
Molecular weight:
71062.0
Reactions
Glycine + Succinyl-CoA → 5-Aminolevulinic acid + Coenzyme Adetails
General function:
Energy production and conversion
Specific function:
Succinyl-CoA synthetase functions in the citric acid cycle (TCA), coupling the hydrolysis of succinyl-CoA to the synthesis of either ATP or GTP and thus represents the only step of substrate-level phosphorylation in the TCA. The alpha subunit of the enzyme binds the substrates coenzyme A and phosphate, while succinate binding and specificity for either ATP or GTP is provided by different beta subunits.
Gene Name:
SUCLG1
Uniprot ID:
Q58DR8
Molecular weight:
36167.0
Reactions
Succinyl-CoA + Hydrogen phosphate + Guanosine diphosphate → Succinic acid + Coenzyme A + Guanosine triphosphatedetails
General function:
Energy production and conversion
Specific function:
GTP-specific succinyl-CoA synthetase functions in the citric acid cycle (TCA), coupling the hydrolysis of succinyl-CoA to the synthesis of GTP and thus represents the only step of substrate-level phosphorylation in the TCA. The beta subunit provides nucleotide specificity of the enzyme and binds the substrate succinate, while the binding sites for coenzyme A and phosphate are found in the alpha subunit.
Gene Name:
SUCLG2
Uniprot ID:
Q3MHX5
Molecular weight:
46691.0
Reactions
Succinyl-CoA + Hydrogen phosphate + Guanosine diphosphate → Succinic acid + Coenzyme A + Guanosine triphosphatedetails
General function:
Energy production and conversion
Specific function:
Dihydrolipoamide succinyltransferase (E2) component of the 2-oxoglutarate dehydrogenase complex (By similarity). The 2-oxoglutarate dehydrogenase complex catalyzes the overall conversion of 2-oxoglutarate to succinyl-CoA and CO(2) (By similarity). The 2-oxoglutarate dehydrogenase complex is mainly active in the mitochondrion. A fraction of the 2-oxoglutarate dehydrogenase complex also localizes in the nucleus and is required for lysine succinylation of histones: associates with KAT2A on chromatin and provides succinyl-CoA to histone succinyltransferase KAT2A (By similarity).
Gene Name:
DLST
Uniprot ID:
P11179
Molecular weight:
48973.0
Reactions
Oxoadipic acid + Coenzyme A → Glutaryl-CoA + Carbon dioxidedetails
General function:
Energy production and conversion
Specific function:
The branched-chain alpha-keto dehydrogenase complex catalyzes the overall conversion of alpha-keto acids to acyl-CoA and CO(2). It contains multiple copies of three enzymatic components: branched-chain alpha-keto acid decarboxylase (E1), lipoamide acyltransferase (E2) and lipoamide dehydrogenase (E3).
Gene Name:
BCKDHA
Uniprot ID:
P11178
Molecular weight:
51678.0
Reactions
2-Ketobutyric acid + Coenzyme A + NAD → Propionyl-CoA + NADHdetails
General function:
Energy production and conversion
Specific function:
The branched-chain alpha-keto dehydrogenase complex catalyzes the overall conversion of alpha-keto acids to acyl-CoA and CO(2). It contains multiple copies of three enzymatic components: branched-chain alpha-keto acid decarboxylase (E1), lipoamide acyltransferase (E2) and lipoamide dehydrogenase (E3).
Gene Name:
BCKDHB
Uniprot ID:
P21839
Molecular weight:
42935.0
Reactions
2-Ketobutyric acid + Coenzyme A + NAD → Propionyl-CoA + NADHdetails
General function:
Energy production and conversion
Specific function:
Required for anchoring dihydrolipoamide dehydrogenase (E3) to the dihydrolipoamide transacetylase (E2) core of the pyruvate dehydrogenase complexes of eukaryotes. This specific binding is essential for a functional PDH complex.
Gene Name:
PDHX
Uniprot ID:
P22439
Molecular weight:
53886.0
Reactions
Pyruvic acid + Coenzyme A + NAD → Acetyl-CoA + Carbon dioxide + NADHdetails
S-Acetyldihydrolipoamide-E + Coenzyme A → Dihydrolipoamide + Acetyl-CoAdetails
General function:
Energy production and conversion
Specific function:
The branched-chain alpha-keto dehydrogenase complex catalyzes the overall conversion of alpha-keto acids to acyl-CoA and CO(2). It contains multiple copies of three enzymatic components: branched-chain alpha-keto acid decarboxylase (E1), lipoamide acyltransferase (E2) and lipoamide dehydrogenase (E3). Within this complex, the catalytic function of this enzyme is to accept, and to transfer to coenzyme A, acyl groups that are generated by the branched-chain alpha-keto acid decarboxylase component.
Gene Name:
DBT
Uniprot ID:
P11181
Molecular weight:
53410.0
Reactions
S-(3-Methylbutanoyl)-dihydrolipoamide-E + Coenzyme A → Isovaleryl-CoA + Dihydrolipoamidedetails
S-(2-Methylpropionyl)-dihydrolipoamide-E + Coenzyme A → Isobutyryl-CoA + Dihydrolipoamidedetails
2-Ketobutyric acid + Coenzyme A + NAD → Propionyl-CoA + NADHdetails
General function:
Energy production and conversion
Specific function:
Catalyzes the oxidation of D-2-hydroxyglutarate to alpha-ketoglutarate.
Gene Name:
D2HGDH
Uniprot ID:
Q1JPD3
Molecular weight:
59056.0
Reactions
Eicosanoyl-CoA + Dihydroxyacetone phosphate → DHAP(18:0) + Coenzyme Adetails
General function:
Lipid transport and metabolism
Specific function:
Esterifies acyl-group from acyl-ACP to the sn-1 position of glycerol-3-phosphate, an essential step in glycerolipid biosynthesis.
Gene Name:
GPAM
Uniprot ID:
Q5GJ77
Molecular weight:
93144.0
Reactions
Glycerol 3-phosphate + Palmityl-CoA → LPA(16:0/0:0) + Coenzyme Adetails
General function:
Involved in glycine N-acyltransferase activity
Specific function:
Mitochondrial acyltransferase which transfers an acyl group to the N-terminus of glycine and glutamine, although much less efficiently. Can conjugate a multitude of substrates to form a variety of N-acylglycines, thereby detoxify xenobiotics, such as benzoic acid or salicylic acid, and endogenous organic acids, such as isovaleric acid.
Gene Name:
GLYAT
Uniprot ID:
Q2KIR7
Molecular weight:
33907.0
Reactions
Phenylacetyl-CoA + L-Glutamine → Alpha-N-Phenylacetyl-L-glutamine + Coenzyme Adetails
General function:
Energy production and conversion
Specific function:
2-oxoglutarate dehydrogenase (E1) component of the 2-oxoglutarate dehydrogenase complex, which mediates the decarboxylation of alpha-ketoglutarate. The 2-oxoglutarate dehydrogenase complex catalyzes the overall conversion of 2-oxoglutarate to succinyl-CoA and CO(2). The 2-oxoglutarate dehydrogenase complex is mainly active in the mitochondrion. A fraction of the 2-oxoglutarate dehydrogenase complex also localizes in the nucleus and is required for lysine succinylation of histones: associates with KAT2A on chromatin and provides succinyl-CoA to histone succinyltransferase KAT2A.
Gene Name:
OGDH
Uniprot ID:
Q148N0
Molecular weight:
115808.0
Reactions
Oxoadipic acid + Coenzyme A → Glutaryl-CoA + Carbon dioxidedetails
General function:
Energy production and conversion
Specific function:
The pyruvate dehydrogenase complex catalyzes the overall conversion of pyruvate to acetyl-CoA and CO(2), and thereby links the glycolytic pathway to the tricarboxylic cycle.
Gene Name:
PDHA1
Uniprot ID:
A7MB35
Molecular weight:
43388.0
Reactions
Pyruvic acid + Coenzyme A + NAD → Acetyl-CoA + Carbon dioxide + NADHdetails
General function:
Energy production and conversion
Specific function:
The pyruvate dehydrogenase complex catalyzes the overall conversion of pyruvate to acetyl-CoA and CO(2), and thereby links the glycolytic pathway to the tricarboxylic cycle.
Gene Name:
PDHB
Uniprot ID:
P11966
Molecular weight:
39126.0
Reactions
Pyruvic acid + Coenzyme A + NAD → Acetyl-CoA + Carbon dioxide + NADHdetails
General function:
Lipid transport and metabolism
Specific function:
Catalyzes the conversion of fatty acids such as long-chain and very long-chain fatty acids to their active form acyl-CoAs for both synthesis of cellular lipids, and degradation via beta-oxidation. Can activate diverse saturated, monosaturated and polyunsaturated fatty acids.
Gene Name:
ACSBG1
Uniprot ID:
Q2KHW5
Molecular weight:
80585.0
Reactions
Palmitic acid + Adenosine triphosphate + Coenzyme A → Palmityl-CoA + Adenosine monophosphate + Pyrophosphatedetails
Phytanic acid + Adenosine triphosphate + Coenzyme A → Phytanoyl-CoA + ADP + Pyrophosphatedetails
Tetracosanoic acid + Adenosine triphosphate + Coenzyme A → Tetracosanoyl-CoA + ADPdetails
Stearic acid + Coenzyme A + Adenosine triphosphate → Stearoyl-CoA + Pyrophosphate + Adenosine monophosphatedetails
General function:
Involved in palmitoyl-(protein) hydrolase activity
Specific function:
Removes thioester-linked fatty acyl groups such as palmitate from modified cysteine residues in proteins or peptides during lysosomal degradation. Prefers acyl chain lengths of 14 to 18 carbons.
Gene Name:
PPT1
Uniprot ID:
P45478
Molecular weight:
34142.0
Reactions
Palmityl-CoA + Water → Palmitic acid + Coenzyme Adetails
General function:
Lipid transport and metabolism
Specific function:
Transmembrane glycoprotein that is the rate-limiting enzyme in cholesterol biosynthesis as well as in the biosynthesis of nonsterol isoprenoids that are essential for normal cell function including ubiquinone and geranylgeranyl proteins.
Gene Name:
HMGCR
Uniprot ID:
A7Z064
Molecular weight:
97727.0
Reactions
3-Hydroxy-3-methylglutaryl-CoA + NADPH → Mevalonic acid + NADP + Coenzyme Adetails
General function:
Not Available
Specific function:
Catalyzes the terminal and only committed step in triacylglycerol synthesis by using diacylglycerol and fatty acyl CoA as substrates. In contrast to DGAT2 it is not essential for survival. May be involved in VLDL (very low density lipoprotein) assembly. Functions as the major acyl-CoA retinol acyltransferase (ARAT) in the skin, where it acts to maintain retinoid homeostasis and prevent retinoid toxicity leading to skin and hair disorders. In liver, plays a role in esterifying exogenous fatty acids to glycerol.
Gene Name:
DGAT1
Uniprot ID:
Q8MK44
Molecular weight:
55602.0
Reactions
1,2-Diacyl-sn-glycerol + Long-chain fatty acyl-CoA → Coenzyme A + Triglyceridedetails
DG(14:0/14:0/0:0) + Palmityl-CoA → TG(14:0/14:0/16:0) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Stearoyl-CoA → TG(14:0/14:0/18:0) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Oleoyl-CoA → TG(14:0/14:0/18:1(9Z)) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Gamma-linolenoyl-CoA → TG(14:0/14:0/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Eicosanoyl-CoA → TG(14:0/14:0/20:0) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Gondoyl-CoA → TG(14:0/14:0/20:1(11Z)) + Coenzyme Adetails
DG(14:0/14:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/14:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Docosanoyl-CoA → TG(14:0/14:0/22:0) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Erucoyl-CoA → TG(14:0/14:0/22:1(13Z)) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Clupanodonyl CoA → TG(14:0/14:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/14:0/0:0) + Tetracosanoyl-CoA → TG(14:0/14:0/24:0) + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Palmitoleyl CoA → TG(14:0/14:1(9Z)/16:1(9Z))[iso6] + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Stearoyl-CoA → TG(14:0/14:1(9Z)/18:0) + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Oleoyl-CoA → TG(14:0/14:1(9Z)/18:1(9Z))[iso6] + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:0/14:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Eicosanoyl-CoA → TG(14:0/14:1(9Z)/20:0) + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Gondoyl-CoA → TG(14:0/14:1(9Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Docosanoyl-CoA → TG(14:0/14:1(9Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Erucoyl-CoA → TG(14:0/14:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Clupanodonyl CoA → TG(14:0/14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/14:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/14:1(9Z)/24:0) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Palmityl-CoA → TG(14:0/15:0/16:0) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Palmitoleyl CoA → TG(14:0/15:0/16:1(9Z)) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Stearoyl-CoA → TG(14:0/15:0/18:0) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Oleoyl-CoA → TG(14:0/15:0/18:1(9Z)) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Gamma-linolenoyl-CoA → TG(14:0/15:0/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Eicosanoyl-CoA → TG(14:0/15:0/20:0) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Gondoyl-CoA → TG(14:0/15:0/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/15:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/15:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Docosanoyl-CoA → TG(14:0/15:0/22:0) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Erucoyl-CoA → TG(14:0/15:0/22:1(13Z)) + Coenzyme Adetails
DG(14:0/15:0/0:0) + Clupanodonyl CoA → TG(14:0/15:0/22:5(7Z,10Z,13Z,16Z,19Z)) [iso6] + Coenzyme Adetails
DG(14:0/15:0/0:0) + Tetracosanoyl-CoA → TG(14:0/15:0/24:0) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Palmityl-CoA → TG(14:0/16:0/16:0) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Palmitoleyl CoA → TG(14:0/16:0/16:1(9Z)) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Stearoyl-CoA → TG(14:0/16:0/18:0) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Oleoyl-CoA → TG(14:0/16:0/18:1(9Z)) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Gamma-linolenoyl-CoA → TG(14:0/16:0/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(14:0/16:0/0:0) + Eicosanoyl-CoA → TG(14:0/16:0/20:0) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Gondoyl-CoA → TG(14:0/16:0/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/16:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/16:0/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:0/16:0/0:0) + Docosanoyl-CoA → TG(14:0/16:0/22:0) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Erucoyl-CoA → TG(14:0/16:0/22:1(13Z)) + Coenzyme Adetails
DG(14:0/16:0/0:0) + Clupanodonyl CoA → TG(14:0/16:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(14:0/16:0/0:0) + Tetracosanoyl-CoA → TG(14:0/16:0/24:0) + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Palmitoleyl CoA → TG(14:0/16:1(9Z)/16:1(9Z))[iso3] + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Stearoyl-CoA → TG(14:0/16:1(9Z)/18:0) + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:0/16:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Eicosanoyl-CoA → TG(14:0/16:1(9Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Gondoyl-CoA → TG(14:0/16:1(9Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Docosanoyl-CoA → TG(14:0/16:1(9Z)/22:0) + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Erucoyl-CoA → TG(14:0/16:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Clupanodonyl CoA → TG(14:0/16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/16:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/16:1(9Z)/24:0) + Coenzyme Adetails
DG(14:0/18:0/0:0) + Stearoyl-CoA → TG(14:0/18:0/18:0) + Coenzyme Adetails
DG(14:0/18:0/0:0) + Oleoyl-CoA → TG(14:0/18:0/18:1(9Z))[iso6] + Coenzyme Adetails
DG(14:0/18:0/0:0) + Gamma-linolenoyl-CoA → TG(14:0/18:0/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(14:0/18:0/0:0) + Eicosanoyl-CoA → TG(14:0/18:0/20:0) + Coenzyme Adetails
DG(14:0/18:0/0:0) + Gondoyl-CoA → TG(14:0/18:0/20:1(11Z)) + Coenzyme Adetails
DG(14:0/18:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/18:0/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:0/18:0/0:0) + Docosanoyl-CoA → TG(14:0/18:0/22:0) + Coenzyme Adetails
DG(14:0/18:0/0:0) + Erucoyl-CoA → TG(14:0/18:0/22:1(13Z)) + Coenzyme Adetails
DG(14:0/18:0/0:0) + Clupanodonyl CoA → TG(14:0/18:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(14:0/18:0/0:0) + Tetracosanoyl-CoA → TG(14:0/18:0/24:0) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Oleoyl-CoA → TG(14:0/18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:0/18:1(11Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Eicosanoyl-CoA → TG(14:0/18:1(11Z)/20:0) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Gondoyl-CoA → TG(14:0/18:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Docosanoyl-CoA → TG(14:0/18:1(11Z)/22:0) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Erucoyl-CoA → TG(14:0/18:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Clupanodonyl CoA → TG(14:0/18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/18:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/18:1(11Z)/24:0) + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Oleoyl-CoA → TG(14:0/18:1(9Z)/18:1(9Z))[iso3] + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:0/18:1(9Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(14:0/18:1(9Z)/20:0) + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Gondoyl-CoA → TG(14:0/18:1(9Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/18:1(9Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Docosanoyl-CoA → TG(14:0/18:1(9Z)/22:0) + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Erucoyl-CoA → TG(14:0/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(14:0/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(14:0/18:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/18:1(9Z)/24:0) + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(14:0/18:2(9Z,12Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(14:0/18:2(9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(14:0/18:2(9Z,12Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(14:0/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(14:0/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/18:2(9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/18:2(9Z,12Z)/24:0) + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(14:0/18:3(6Z,9Z,12Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(14:0/18:3(6Z,9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(14:0/18:3(6Z,9Z,12Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(14:0/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(14:0/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/18:3(6Z,9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/18:3(6Z,9Z,12Z)/24:0) + Coenzyme Adetails
DG(14:0/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(14:0/18:3(9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:0/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(14:0/18:3(9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(14:0/18:3(9Z,12Z,15Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:0/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(14:0/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(14:0/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/18:3(9Z,12Z,15Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/18:3(9Z,12Z,15Z)/24:0) + Coenzyme Adetails
DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(14:0/18:4(6Z,9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(14:0/18:4(6Z,9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(14:0/18:4(6Z,9Z,12Z,15Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(14:0/18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(14:0/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/18:4(6Z,9Z,12Z,15Z)/24:0) + Coenzyme Adetails
DG(14:0/20:0/0:0) + Eicosanoyl-CoA → TG(14:0/20:0/20:0) + Coenzyme Adetails
DG(14:0/20:0/0:0) + Gondoyl-CoA → TG(14:0/20:0/20:1(11Z)) + Coenzyme Adetails
DG(14:0/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/20:0/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:0/20:0/0:0) + Docosanoyl-CoA → TG(14:0/20:0/22:0) + Coenzyme Adetails
DG(14:0/20:0/0:0) + Erucoyl-CoA → TG(14:0/20:0/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:0/0:0) + Clupanodonyl CoA → TG(14:0/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/20:0/0:0) + Tetracosanoyl-CoA → TG(14:0/20:0/24:0) + Coenzyme Adetails
DG(14:0/20:1(11Z)/0:0) + Gondoyl-CoA → TG(14:0/20:1(11Z)/20:1(11Z))[iso3] + Coenzyme Adetails
DG(14:0/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/20:1(11Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:0/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(14:0/20:1(11Z)/22:0) + Coenzyme Adetails
DG(14:0/20:1(11Z)/0:0) + Erucoyl-CoA → TG(14:0/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(14:0/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(14:0/20:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/20:1(11Z)/24:0) + Coenzyme Adetails
DG(14:0/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:0/20:2(11Z,14Z)/0:0) + Docosanoyl-CoA → TG(14:0/20:2n6/22:0) + Coenzyme Adetails
DG(14:0/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(14:0/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(14:0/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/20:2(11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/20:2n6/24:0) + Coenzyme Adetails
DG(14:0/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/20:3(5Z,8Z,11Z)/0:0) + Docosanoyl-CoA → TG(14:0/20:3(5Z,8Z,11Z)/22:0) + Coenzyme Adetails
DG(14:0/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(14:0/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(14:0/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/20:3(5Z,8Z,11Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/20:3(5Z,8Z,11Z)/24:0) + Coenzyme Adetails
DG(14:0/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/20:3(8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(14:0/20:3n6/22:0) + Coenzyme Adetails
DG(14:0/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(14:0/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(14:0/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/20:3(8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/20:3n6/24:0) + Coenzyme Adetails
DG(14:0/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:0/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(14:0/20:4(5Z,8Z,11Z,14Z)/22:0) + Coenzyme Adetails
DG(14:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(14:0/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(14:0/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/20:4(5Z,8Z,11Z,14Z)/24:0) + Coenzyme Adetails
DG(14:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(14:0/20:4(8Z,11Z,14Z,17Z)/22:0) + Coenzyme Adetails
DG(14:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(14:0/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(14:0/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/20:4(8Z,11Z,14Z,17Z)/24:0) + Coenzyme Adetails
DG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:0) + Coenzyme Adetails
DG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/24:0) + Coenzyme Adetails
DG(14:0/22:0/0:0) + Docosanoyl-CoA → TG(14:0/22:0/22:0) + Coenzyme Adetails
DG(14:0/22:0/0:0) + Erucoyl-CoA → TG(14:0/22:0/22:1(13Z)) + Coenzyme Adetails
DG(14:0/22:0/0:0) + Clupanodonyl CoA → TG(14:0/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/22:0/0:0) + Tetracosanoyl-CoA → TG(14:0/22:0/24:0) + Coenzyme Adetails
DG(14:0/22:1(13Z)/0:0) + Erucoyl-CoA → TG(14:0/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:0/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(14:0/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/22:1(13Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/22:1(13Z)/24:0) + Coenzyme Adetails
DG(14:0/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(14:0/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/22:2(13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/22:2(13Z,16Z)/24:0) + Coenzyme Adetails
DG(14:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(14:0/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/22:4(7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(14:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(14:0/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/22:5(4Z,7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(14:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(14:0/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/22:5(7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(14:0/24:0/0:0) + Tetracosanoyl-CoA → TG(14:0/24:0/24:0) + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Palmityl-CoA → TG(14:1(9Z)/14:1(9Z)/16:0)[iso3] + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Palmitoleyl CoA → TG(14:1(9Z)/14:1(9Z)/16:1(9Z)) + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Stearoyl-CoA → TG(14:1(9Z)/14:1(9Z)/18:0)[iso3] + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Oleoyl-CoA → TG(14:1(9Z)/14:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/14:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/14:1(9Z)/20:0)[iso3] + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/14:1(9Z)/20:1(11Z))[iso3] + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/14:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/14:1(9Z)/22:0)[iso3] + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/14:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/14:1(9Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Palmitoleyl CoA → TG(14:1(9Z)/15:0/16:1(9Z)) + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Oleoyl-CoA → TG(14:1(9Z)/15:0/18:1(9Z)) + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/15:0/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/15:0/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Gondoyl-CoA → TG(14:1(9Z)/15:0/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/15:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/15:0/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Erucoyl-CoA → TG(14:1(9Z)/15:0/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/15:0/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/15:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + Palmitoleyl CoA → TG(14:1(9Z)/16:0/16:1(9Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + Oleoyl-CoA → TG(14:1(9Z)/16:0/18:1(9Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/16:0/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/16:0/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + Gondoyl-CoA → TG(14:1(9Z)/16:0/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/16:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + Erucoyl-CoA → TG(14:1(9Z)/16:0/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:0/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/16:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Palmitoleyl CoA → TG(14:1(9Z)/16:1(9Z)/16:1(9Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Stearoyl-CoA → TG(14:1(9Z)/16:1(9Z)/18:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Oleoyl-CoA → TG(14:1(9Z)/16:1(9Z)/18:1(9Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/16:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/16:1(9Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/16:1(9Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/16:1(9Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/16:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/16:1(9Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:0/0:0) + Stearoyl-CoA → TG(14:1(9Z)/18:0/18:0)[iso3] + Coenzyme Adetails
DG(14:1(9Z)/18:0/0:0) + Oleoyl-CoA → TG(14:1(9Z)/18:0/18:1(9Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:0/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/18:0/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:0/0:0) + Gondoyl-CoA → TG(14:1(9Z)/18:0/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/18:0/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:0/0:0) + Erucoyl-CoA → TG(14:1(9Z)/18:0/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:0/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/18:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:1(11Z)/0:0) + Oleoyl-CoA → TG(14:1(9Z)/18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/18:1(11Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(11Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/18:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(11Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/18:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(11Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + Oleoyl-CoA → TG(14:1(9Z)/18:1(9Z)/18:1(9Z))[iso3] + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/18:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/18:1(9Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/18:1(9Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/18:1(9Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/18:2(9Z,12Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/18:2(9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/18:2(9Z,12Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(14:1(9Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/18:3(6Z,9Z,12Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/18:3(6Z,9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/18:3(6Z,9Z,12Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/18:3(9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/18:3(9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/18:3(9Z,12Z,15Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:0/0:0) + Gondoyl-CoA → TG(14:1(9Z)/20:0/20:1(11Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/20:0/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/20:0/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:0/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:0/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(14:1(9Z)/20:1(11Z)/20:1(11Z))[iso3] + Coenzyme Adetails
DG(14:1(9Z)/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/20:1(11Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(14:1(9Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:0)[iso6] + Coenzyme Adetails
DG(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:0/0:0) + Erucoyl-CoA → TG(14:1(9Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:0/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(14:1(9Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Palmityl-CoA → TG(15:0/15:0/16:0) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Palmitoleyl CoA → TG(15:0/15:0/16:1(9Z)) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Stearoyl-CoA → TG(15:0/15:0/18:0) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Oleoyl-CoA → TG(15:0/15:0/18:1(9Z)) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Gamma-linolenoyl-CoA → TG(15:0/15:0/18:3(6Z,9Z,12Z))[iso3] + Coenzyme Adetails
DG(15:0/15:0/0:0) + Eicosanoyl-CoA → TG(15:0/15:0/20:0) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Gondoyl-CoA → TG(15:0/15:0/20:1(11Z))[iso3] + Coenzyme Adetails
DG(15:0/15:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/15:0/20:4(5Z,8Z,11Z,14Z))[iso3] + Coenzyme Adetails
DG(15:0/15:0/0:0) + Docosanoyl-CoA → TG(15:0/15:0/22:0) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Erucoyl-CoA → TG(15:0/15:0/22:1(13Z)) + Coenzyme Adetails
DG(15:0/15:0/0:0) + Clupanodonyl CoA → TG(15:0/15:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso3] + Coenzyme Adetails
DG(15:0/15:0/0:0) + Tetracosanoyl-CoA → TG(15:0/15:0/24:0) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Palmityl-CoA → TG(15:0/16:0/16:0) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Palmitoleyl CoA → TG(15:0/16:0/16:1(9Z)) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Stearoyl-CoA → TG(15:0/16:0/18:0) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Oleoyl-CoA → TG(15:0/16:0/18:1(9Z))[iso6] + Coenzyme Adetails
DG(15:0/16:0/0:0) + Gamma-linolenoyl-CoA → TG(15:0/16:0/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Eicosanoyl-CoA → TG(15:0/16:0/20:0) + Coenzyme Adetails
DG(15:0/16:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/16:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Docosanoyl-CoA → TG(15:0/16:0/22:0) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Erucoyl-CoA → TG(15:0/16:0/22:1(13Z)) + Coenzyme Adetails
DG(15:0/16:0/0:0) + Clupanodonyl CoA → TG(15:0/16:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(15:0/16:0/0:0) + Tetracosanoyl-CoA → TG(15:0/16:0/24:0) + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Palmitoleyl CoA → TG(15:0/16:1(9Z)/16:1(9Z)) + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Stearoyl-CoA → TG(15:0/16:1(9Z)/18:0)[iso6] + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Oleoyl-CoA → TG(15:0/16:1(9Z)/18:1(9Z))[iso6] + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(15:0/16:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Gondoyl-CoA → TG(15:0/16:1(9Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) [iso6] + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Docosanoyl-CoA → TG(15:0/16:1(9Z)/22:0) + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Erucoyl-CoA → TG(15:0/16:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Clupanodonyl CoA → TG(15:0/16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(15:0/16:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/16:1(9Z)/24:0) + Coenzyme Adetails
DG(15:0/18:0/0:0) + Stearoyl-CoA → TG(15:0/18:0/18:0) + Coenzyme Adetails
DG(15:0/18:0/0:0) + Gamma-linolenoyl-CoA → TG(15:0/18:0/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(15:0/18:0/0:0) + Eicosanoyl-CoA → TG(15:0/18:0/20:0) + Coenzyme Adetails
DG(15:0/18:0/0:0) + Gondoyl-CoA → TG(15:0/18:0/20:1(11Z)) + Coenzyme Adetails
DG(15:0/18:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/18:0/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(15:0/18:0/0:0) + Docosanoyl-CoA → TG(15:0/18:0/22:0) + Coenzyme Adetails
DG(15:0/18:0/0:0) + Erucoyl-CoA → TG(15:0/18:0/22:1(13Z)) + Coenzyme Adetails
DG(15:0/18:0/0:0) + Clupanodonyl CoA → TG(15:0/18:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/18:0/0:0) + Tetracosanoyl-CoA → TG(15:0/18:0/24:0) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Oleoyl-CoA → TG(15:0/18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → TG(15:0/18:1(11Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Eicosanoyl-CoA → TG(15:0/18:1(11Z)/20:0) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Gondoyl-CoA → TG(15:0/18:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Docosanoyl-CoA → TG(15:0/18:1(11Z)/22:0) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Erucoyl-CoA → TG(15:0/18:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Clupanodonyl CoA → TG(15:0/18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/18:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/18:1(11Z)/24:0) + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Oleoyl-CoA → TG(15:0/18:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(15:0/18:1(9Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(15:0/18:1(9Z)/20:0) + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Gondoyl-CoA → TG(15:0/18:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/18:1(9Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Docosanoyl-CoA → TG(15:0/18:1(9Z)/22:0) + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Erucoyl-CoA → TG(15:0/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(15:0/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(15:0/18:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/18:1(9Z)/24:0) + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(15:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) [iso6] + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(15:0/18:2(9Z,12Z)/20:0) + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(15:0/18:2(9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(15:0/18:2(9Z,12Z)/22:0) + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(15:0/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(15:0/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(15:0/18:2(9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/18:2(9Z,12Z)/24:0) + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(15:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(15:0/18:3(6Z,9Z,12Z)/20:0)[iso6] + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(15:0/18:3(6Z,9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(15:0/18:3(6Z,9Z,12Z)/22:0) + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(15:0/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(15:0/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(15:0/18:3(6Z,9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/18:3(6Z,9Z,12Z)/24:0) + Coenzyme Adetails
DG(15:0/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(15:0/18:3(9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(15:0/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(15:0/18:3(9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(15:0/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(15:0/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(15:0/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(15:0/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(15:0/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(15:0/18:3(9Z,12Z,15Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/18:3(9Z,12Z,15Z)/24:0) + Coenzyme Adetails
DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(15:0/18:4(6Z,9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(15:0/18:4(6Z,9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(15:0/18:4(6Z,9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(15:0/18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(15:0/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/18:4(6Z,9Z,12Z,15Z)/24:0) + Coenzyme Adetails
DG(15:0/20:0/0:0) + Eicosanoyl-CoA → TG(15:0/20:0/20:0) + Coenzyme Adetails
DG(15:0/20:0/0:0) + Gondoyl-CoA → TG(15:0/20:0/20:1(11Z)) + Coenzyme Adetails
DG(15:0/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/20:0/0:0) + Docosanoyl-CoA → TG(15:0/20:0/22:0) + Coenzyme Adetails
DG(15:0/20:0/0:0) + Erucoyl-CoA → TG(15:0/20:0/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:0/0:0) + Clupanodonyl CoA → TG(15:0/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:0/0:0) + Tetracosanoyl-CoA → TG(15:0/20:0/24:0) + Coenzyme Adetails
DG(15:0/20:1(11Z)/0:0) + Gondoyl-CoA → TG(15:0/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(15:0/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(15:0/20:1(11Z)/22:0) + Coenzyme Adetails
DG(15:0/20:1(11Z)/0:0) + Erucoyl-CoA → TG(15:0/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(15:0/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/20:1(11Z)/24:0) + Coenzyme Adetails
DG(15:0/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(15:0/20:2(11Z,14Z)/0:0) + Docosanoyl-CoA → TG(15:0/20:2n6/22:0) + Coenzyme Adetails
DG(15:0/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(15:0/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(15:0/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:2(11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/20:2n6/24:0) + Coenzyme Adetails
DG(15:0/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(15:0/20:3(5Z,8Z,11Z)/0:0) + Docosanoyl-CoA → TG(15:0/20:3(5Z,8Z,11Z)/22:0) + Coenzyme Adetails
DG(15:0/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(15:0/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(15:0/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:3(5Z,8Z,11Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/20:3(5Z,8Z,11Z)/24:0) + Coenzyme Adetails
DG(15:0/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(15:0/20:3(8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(15:0/20:3n6/22:0) + Coenzyme Adetails
DG(15:0/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(15:0/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(15:0/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:3(8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/20:3n6/24:0) + Coenzyme Adetails
DG(15:0/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(15:0/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z))[iso3] + Coenzyme Adetails
DG(15:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(15:0/20:4(5Z,8Z,11Z,14Z)/22:0) + Coenzyme Adetails
DG(15:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(15:0/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(15:0/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/20:4(5Z,8Z,11Z,14Z)/24:0) + Coenzyme Adetails
DG(15:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(15:0/20:4(8Z,11Z,14Z,17Z)/22:0) + Coenzyme Adetails
DG(15:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(15:0/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(15:0/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/20:4(8Z,11Z,14Z,17Z)/24:0) + Coenzyme Adetails
DG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:0) + Coenzyme Adetails
DG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/24:0) + Coenzyme Adetails
DG(15:0/22:0/0:0) + Docosanoyl-CoA → TG(15:0/22:0/22:0) + Coenzyme Adetails
DG(15:0/22:0/0:0) + Erucoyl-CoA → TG(15:0/22:0/22:1(13Z)) + Coenzyme Adetails
DG(15:0/22:0/0:0) + Clupanodonyl CoA → TG(15:0/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/22:0/0:0) + Tetracosanoyl-CoA → TG(15:0/22:0/24:0) + Coenzyme Adetails
DG(15:0/22:1(13Z)/0:0) + Erucoyl-CoA → TG(15:0/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(15:0/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(15:0/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/22:1(13Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/22:1(13Z)/24:0) + Coenzyme Adetails
DG(15:0/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(15:0/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/22:2(13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/22:2(13Z,16Z)/24:0) + Coenzyme Adetails
DG(15:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(15:0/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/22:4(7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(15:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(15:0/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/22:5(4Z,7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(15:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(15:0/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(15:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/22:5(7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(15:0/24:0/0:0) + Tetracosanoyl-CoA → TG(15:0/24:0/24:0) + Coenzyme Adetails
DG(16:0/16:0/0:0) + Palmityl-CoA → TG(16:0/16:0/16:0)[iso] + Coenzyme Adetails
DG(16:0/16:0/0:0) + Palmitoleyl CoA → TG(16:0/16:0/16:1(9Z)) + Coenzyme Adetails
DG(16:0/16:0/0:0) + Stearoyl-CoA → TG(16:0/16:0/18:0)[iso3] + Coenzyme Adetails
DG(16:0/16:0/0:0) + Oleoyl-CoA → TG(16:0/16:0/18:1(9Z)) + Coenzyme Adetails
DG(16:0/16:0/0:0) + Gamma-linolenoyl-CoA → TG(16:0/16:0/18:3(6Z,9Z,12Z))[iso3] + Coenzyme Adetails
DG(16:0/16:0/0:0) + Eicosanoyl-CoA → TG(16:0/16:0/20:0)[iso3] + Coenzyme Adetails
DG(16:0/16:0/0:0) + Gondoyl-CoA → TG(16:0/16:0/20:1(11Z)) + Coenzyme Adetails
DG(16:0/16:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/16:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/16:0/0:0) + Docosanoyl-CoA → TG(16:0/16:0/22:0) + Coenzyme Adetails
DG(16:0/16:0/0:0) + Erucoyl-CoA → TG(16:0/16:0/22:1(13Z)) + Coenzyme Adetails
DG(16:0/16:0/0:0) + Clupanodonyl CoA → TG(16:0/16:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso3] + Coenzyme Adetails
DG(16:0/16:0/0:0) + Tetracosanoyl-CoA → TG(16:0/16:0/24:0) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Palmitoleyl CoA → TG(16:0/16:1(9Z)/16:1(9Z)) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Stearoyl-CoA → TG(16:0/16:1(9Z)/18:0) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Oleoyl-CoA → TG(16:0/16:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:0/16:1(9Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Eicosanoyl-CoA → TG(16:0/16:1(9Z)/20:0) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Gondoyl-CoA → TG(16:0/16:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Docosanoyl-CoA → TG(16:0/16:1(9Z)/22:0) + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Erucoyl-CoA → TG(16:0/16:1(9Z)/22:1(13Z))[iso6] + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Clupanodonyl CoA → TG(16:0/16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(16:0/16:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/16:1(9Z)/24:0) + Coenzyme Adetails
DG(16:0/18:0/0:0) + Stearoyl-CoA → TG(16:0/18:0/18:0)[iso3] + Coenzyme Adetails
DG(16:0/18:0/0:0) + Oleoyl-CoA → TG(16:0/18:0/18:1(9Z)) + Coenzyme Adetails
DG(16:0/18:0/0:0) + Gamma-linolenoyl-CoA → TG(16:0/18:0/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(16:0/18:0/0:0) + Eicosanoyl-CoA → TG(16:0/18:0/20:0)[iso6] + Coenzyme Adetails
DG(16:0/18:0/0:0) + Gondoyl-CoA → TG(16:0/18:0/20:1(11Z)) + Coenzyme Adetails
DG(16:0/18:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/18:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/18:0/0:0) + Docosanoyl-CoA → TG(16:0/18:0/22:0) + Coenzyme Adetails
DG(16:0/18:0/0:0) + Erucoyl-CoA → TG(16:0/18:0/22:1(13Z)) + Coenzyme Adetails
DG(16:0/18:0/0:0) + Clupanodonyl CoA → TG(16:0/18:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/18:0/0:0) + Tetracosanoyl-CoA → TG(16:0/18:0/24:0) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Oleoyl-CoA → TG(16:0/18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:0/18:1(11Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Eicosanoyl-CoA → TG(16:0/18:1(11Z)/20:0) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Gondoyl-CoA → TG(16:0/18:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Docosanoyl-CoA → TG(16:0/18:1(11Z)/22:0) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Erucoyl-CoA → TG(16:0/18:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Clupanodonyl CoA → TG(16:0/18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/18:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/18:1(11Z)/24:0) + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Oleoyl-CoA → TG(16:0/18:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:0/18:1(9Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(16:0/18:1(9Z)/20:0) + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Gondoyl-CoA → TG(16:0/18:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Docosanoyl-CoA → TG(16:0/18:1(9Z)/22:0) + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Erucoyl-CoA → TG(16:0/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(16:0/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(16:0/18:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/18:1(9Z)/24:0) + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(16:0/18:2(9Z,12Z)/20:0) + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(16:0/18:2(9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(16:0/18:2(9Z,12Z)/22:0) + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(16:0/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(16:0/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/18:2(9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/18:2(9Z,12Z)/24:0) + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(16:0/18:3(6Z,9Z,12Z)/20:0)[iso6] + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(16:0/18:3(6Z,9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(16:0/18:3(6Z,9Z,12Z)/22:0) + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(16:0/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(16:0/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/18:3(6Z,9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/18:3(6Z,9Z,12Z)/24:0) + Coenzyme Adetails
DG(16:0/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(16:0/18:3(9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(16:0/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(16:0/18:3(9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(16:0/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(16:0/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(16:0/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(16:0/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(16:0/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/18:3(9Z,12Z,15Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/18:3(9Z,12Z,15Z)/24:0) + Coenzyme Adetails
DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(16:0/18:4(6Z,9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(16:0/18:4(6Z,9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(16:0/18:4(6Z,9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(16:0/18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(16:0/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/18:4(6Z,9Z,12Z,15Z)/24:0) + Coenzyme Adetails
DG(16:0/20:0/0:0) + Eicosanoyl-CoA → TG(16:0/20:0/20:0)[iso3] + Coenzyme Adetails
DG(16:0/20:0/0:0) + Gondoyl-CoA → TG(16:0/20:0/20:1(11Z)) + Coenzyme Adetails
DG(16:0/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/20:0/0:0) + Docosanoyl-CoA → TG(16:0/20:0/22:0) + Coenzyme Adetails
DG(16:0/20:0/0:0) + Erucoyl-CoA → TG(16:0/20:0/22:1(13Z)) + Coenzyme Adetails
DG(16:0/20:0/0:0) + Clupanodonyl CoA → TG(16:0/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/20:0/0:0) + Tetracosanoyl-CoA → TG(16:0/20:0/24:0) + Coenzyme Adetails
DG(16:0/20:1(11Z)/0:0) + Gondoyl-CoA → TG(16:0/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:0/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(16:0/20:1(11Z)/22:0) + Coenzyme Adetails
DG(16:0/20:1(11Z)/0:0) + Erucoyl-CoA → TG(16:0/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(16:0/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/20:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/20:1(11Z)/24:0) + Coenzyme Adetails
DG(16:0/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z))[iso6] + Coenzyme Adetails
DG(16:0/20:2(11Z,14Z)/0:0) + Docosanoyl-CoA → TG(16:0/20:2n6/22:0) + Coenzyme Adetails
DG(16:0/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(16:0/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(16:0/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(16:0/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/20:2(11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/20:2n6/24:0) + Coenzyme Adetails
DG(16:0/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/20:3(5Z,8Z,11Z)/0:0) + Docosanoyl-CoA → TG(16:0/20:3(5Z,8Z,11Z)/22:0) + Coenzyme Adetails
DG(16:0/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(16:0/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(16:0/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/20:3(5Z,8Z,11Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/20:3(5Z,8Z,11Z)/24:0) + Coenzyme Adetails
DG(16:0/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/20:3(8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(16:0/20:3n6/22:0) + Coenzyme Adetails
DG(16:0/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(16:0/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(16:0/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(16:0/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/20:3(8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/20:3n6/24:0) + Coenzyme Adetails
DG(16:0/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:0/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(16:0/20:4(5Z,8Z,11Z,14Z)/22:0) + Coenzyme Adetails
DG(16:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(16:0/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(16:0/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/20:4(5Z,8Z,11Z,14Z)/24:0) + Coenzyme Adetails
DG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:0) + Coenzyme Adetails
DG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/24:0) + Coenzyme Adetails
DG(16:0/22:0/0:0) + Docosanoyl-CoA → TG(16:0/22:0/22:0) + Coenzyme Adetails
DG(16:0/22:0/0:0) + Erucoyl-CoA → TG(16:0/22:0/22:1(13Z)) + Coenzyme Adetails
DG(16:0/22:0/0:0) + Clupanodonyl CoA → TG(16:0/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/22:0/0:0) + Tetracosanoyl-CoA → TG(16:0/22:0/24:0) + Coenzyme Adetails
DG(16:0/22:1(13Z)/0:0) + Erucoyl-CoA → TG(16:0/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:0/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(16:0/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/22:1(13Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/22:1(13Z)/24:0) + Coenzyme Adetails
DG(16:0/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(16:0/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/22:2(13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/22:2(13Z,16Z)/24:0) + Coenzyme Adetails
DG(16:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(16:0/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/22:4(7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(16:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(16:0/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/22:5(4Z,7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(16:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(16:0/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/22:5(7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(16:0/24:0/0:0) + Tetracosanoyl-CoA → TG(16:0/24:0/24:0) + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Palmitoleyl CoA → TG(16:1(9Z)/16:1(9Z)/16:1(9Z))[iso] + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Stearoyl-CoA → TG(16:1(9Z)/16:1(9Z)/18:0) + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Oleoyl-CoA → TG(16:1(9Z)/16:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:1(9Z)/16:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/16:1(9Z)/20:0) + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/16:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/16:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Docosanoyl-CoA → TG(16:1(9Z)/16:1(9Z)/22:0)[iso3] + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/16:1(9Z)/22:1(13Z))[iso3] + Coenzyme Adetails
DG(16:1(9Z)/16:1(9Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + Stearoyl-CoA → TG(16:1(9Z)/18:0/18:0) + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + Oleoyl-CoA → TG(16:1(9Z)/18:0/18:1(9Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + Gamma-linolenoyl-CoA → TG(16:1(9Z)/18:0/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/18:0/20:0) + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + Gondoyl-CoA → TG(16:1(9Z)/18:0/20:1(11Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/18:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + Erucoyl-CoA → TG(16:1(9Z)/18:0/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:0/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/18:0/22:5(7Z,10Z,13Z,16Z,19Z))[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:1(11Z)/0:0) + Oleoyl-CoA → TG(16:1(9Z)/18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:1(9Z)/18:1(11Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(11Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/18:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(11Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/18:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(11Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(9Z)/0:0) + Oleoyl-CoA → TG(16:1(9Z)/18:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:1(9Z)/18:1(9Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/18:1(9Z)/20:0) + Coenzyme Adetails
DG(16:1(9Z)/18:1(9Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/18:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(9Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:1(9Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/18:2(9Z,12Z)/20:0) + Coenzyme Adetails
DG(16:1(9Z)/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/18:2(9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(16:1(9Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/18:3(6Z,9Z,12Z)/20:0)[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/18:3(6Z,9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/18:3(9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/18:3(9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:0/0:0) + Eicosanoyl-CoA → TG(16:1(9Z)/20:0/20:0) + Coenzyme Adetails
DG(16:1(9Z)/20:0/0:0) + Gondoyl-CoA → TG(16:1(9Z)/20:0/20:1(11Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:0/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:0/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:0/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(16:1(9Z)/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:0/0:0) + Erucoyl-CoA → TG(16:1(9Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:0/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(16:1(9Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/18:0/0:0) + Stearoyl-CoA → TG(18:0/18:0/18:0) + Coenzyme Adetails
DG(18:0/18:0/0:0) + Oleoyl-CoA → TG(18:0/18:0/18:1(9Z)) + Coenzyme Adetails
DG(18:0/18:0/0:0) + Gamma-linolenoyl-CoA → TG(18:0/18:0/18:3(6Z,9Z,12Z))[iso3] + Coenzyme Adetails
DG(18:0/18:0/0:0) + Eicosanoyl-CoA → TG(18:0/18:0/20:0)[iso3] + Coenzyme Adetails
DG(18:0/18:0/0:0) + Gondoyl-CoA → TG(18:0/18:0/20:1(11Z)) + Coenzyme Adetails
DG(18:0/18:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/18:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/18:0/0:0) + Docosanoyl-CoA → TG(18:0/18:0/22:0) + Coenzyme Adetails
DG(18:0/18:0/0:0) + Erucoyl-CoA → TG(18:0/18:0/22:1(13Z)) + Coenzyme Adetails
DG(18:0/18:0/0:0) + Clupanodonyl CoA → TG(18:0/18:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/18:0/0:0) + Tetracosanoyl-CoA → TG(18:0/18:0/24:0) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Oleoyl-CoA → TG(18:0/18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:0/18:1(11Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Eicosanoyl-CoA → TG(18:0/18:1(11Z)/20:0) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Gondoyl-CoA → TG(18:0/18:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:0/18:1(11Z)/22:0) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Erucoyl-CoA → TG(18:0/18:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:0/18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/18:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/18:1(11Z)/24:0) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Oleoyl-CoA → TG(18:0/18:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:0/18:1(9Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(18:0/18:1(9Z)/20:0) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Gondoyl-CoA → TG(18:0/18:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Docosanoyl-CoA → TG(18:0/18:1(9Z)/22:0) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Erucoyl-CoA → TG(18:0/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(18:0/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/18:1(9Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/18:1(9Z)/24:0) + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:0/18:2(9Z,12Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:0/18:2(9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:0/18:2(9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:0/18:2(9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:0/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:0/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/18:2(9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/18:2(9Z,12Z)/24:0) + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:0/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z))[iso3] + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:0/18:3(6Z,9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:0/18:3(6Z,9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:0/18:3(6Z,9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:0/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:0/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/18:3(6Z,9Z,12Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/18:3(6Z,9Z,12Z)/24:0) + Coenzyme Adetails
DG(18:0/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(18:0/18:3(9Z,12Z,15Z)/20:0) + Coenzyme Adetails
DG(18:0/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:0/18:3(9Z,12Z,15Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:0/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(18:0/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(18:0/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:0/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/20:0/0:0) + Eicosanoyl-CoA → TG(18:0/20:0/20:0)[iso3] + Coenzyme Adetails
DG(18:0/20:0/0:0) + Gondoyl-CoA → TG(18:0/20:0/20:1(11Z)) + Coenzyme Adetails
DG(18:0/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/20:0/0:0) + Docosanoyl-CoA → TG(18:0/20:0/22:0) + Coenzyme Adetails
DG(18:0/20:0/0:0) + Erucoyl-CoA → TG(18:0/20:0/22:1(13Z)) + Coenzyme Adetails
DG(18:0/20:0/0:0) + Clupanodonyl CoA → TG(18:0/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/20:0/0:0) + Tetracosanoyl-CoA → TG(18:0/20:0/24:0) + Coenzyme Adetails
DG(18:0/20:1(11Z)/0:0) + Gondoyl-CoA → TG(18:0/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:0/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:0/20:1(11Z)/22:0) + Coenzyme Adetails
DG(18:0/20:1(11Z)/0:0) + Erucoyl-CoA → TG(18:0/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:0/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/20:1(11Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/20:1(11Z)/24:0) + Coenzyme Adetails
DG(18:0/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/20:2(11Z,14Z)/0:0) + Docosanoyl-CoA → TG(18:0/20:2n6/22:0) + Coenzyme Adetails
DG(18:0/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(18:0/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(18:0/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:0/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/20:2(11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/20:2n6/24:0) + Coenzyme Adetails
DG(18:0/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/20:3(5Z,8Z,11Z)/0:0) + Docosanoyl-CoA → TG(18:0/20:3(5Z,8Z,11Z)/22:0) + Coenzyme Adetails
DG(18:0/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(18:0/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(18:0/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/20:3(5Z,8Z,11Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/20:3(5Z,8Z,11Z)/24:0) + Coenzyme Adetails
DG(18:0/20:3(8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(18:0/20:3n6/22:0) + Coenzyme Adetails
DG(18:0/20:3(8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/20:3n6/24:0) + Coenzyme Adetails
DG(18:0/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:0/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:0/22:0/0:0) + Docosanoyl-CoA → TG(18:0/22:0/22:0) + Coenzyme Adetails
DG(18:0/22:0/0:0) + Erucoyl-CoA → TG(18:0/22:0/22:1(13Z)) + Coenzyme Adetails
DG(18:0/22:0/0:0) + Clupanodonyl CoA → TG(18:0/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/22:0/0:0) + Tetracosanoyl-CoA → TG(18:0/22:0/24:0) + Coenzyme Adetails
DG(18:0/22:1(13Z)/0:0) + Erucoyl-CoA → TG(18:0/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:0/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(18:0/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:0/22:1(13Z)/0:0) + Tetracosanoyl-CoA → TG(18:0/22:1(13Z)/24:0) + Coenzyme Adetails
DG(18:0/24:0/0:0) + Tetracosanoyl-CoA → TG(18:0/24:0/24:0) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + Oleoyl-CoA → TG(18:1(11Z)/18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:1(11Z)/18:1(11Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + Eicosanoyl-CoA → TG(18:1(11Z)/18:1(11Z)/20:0) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + Gondoyl-CoA → TG(18:1(11Z)/18:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/18:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/18:1(11Z)/22:0) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/18:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + Oleoyl-CoA → TG(18:1(11Z)/18:1(9Z)/18:1(9Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:1(11Z)/18:1(9Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(18:1(11Z)/18:1(9Z)/20:0) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + Gondoyl-CoA → TG(18:1(11Z)/18:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/18:1(9Z)/22:0) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:1(11Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:1(11Z)/18:2(9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:1(11Z)/18:2(9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/18:2(9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:1(11Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:1(11Z)/18:3(6Z,9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:1(11Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/18:3(6Z,9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(18:1(11Z)/18:3(9Z,12Z,15Z)/20:0) + Coenzyme Adetails
DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:1(11Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:0/0:0) + Eicosanoyl-CoA → TG(18:1(11Z)/20:0/20:0) + Coenzyme Adetails
DG(18:1(11Z)/20:0/0:0) + Gondoyl-CoA → TG(18:1(11Z)/20:0/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:0/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/20:0/22:0) + Coenzyme Adetails
DG(18:1(11Z)/20:0/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:0/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:0/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(18:1(11Z)/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/20:1(11Z)/22:0) + Coenzyme Adetails
DG(18:1(11Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:0/0:0) + Docosanoyl-CoA → TG(18:1(11Z)/22:0/22:0) + Coenzyme Adetails
DG(18:1(11Z)/22:0/0:0) + Erucoyl-CoA → TG(18:1(11Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:0/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(18:1(11Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + Oleoyl-CoA → TG(18:1(9Z)/18:1(9Z)/18:1(9Z))[iso] + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:1(9Z)/18:1(9Z)/18:3(6Z,9Z,12Z))[iso3] + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + Eicosanoyl-CoA → TG(18:1(9Z)/18:1(9Z)/20:0) + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + Gondoyl-CoA → TG(18:1(9Z)/18:1(9Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/18:1(9Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + Docosanoyl-CoA → TG(18:1(9Z)/18:1(9Z)/22:0) + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/18:1(9Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:1(9Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:1(9Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z))[iso6] + Coenzyme Adetails
DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:1(9Z)/18:2(9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:1(9Z)/18:2(9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:1(9Z)/18:2(9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:1(9Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:1(9Z)/18:3(6Z,9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:1(9Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:1(9Z)/18:3(6Z,9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(18:1(9Z)/18:3(9Z,12Z,15Z)/20:0) + Coenzyme Adetails
DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:1(9Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(18:1(9Z)/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:0/0:0) + Eicosanoyl-CoA → TG(18:1(9Z)/20:0/20:0) + Coenzyme Adetails
DG(18:1(9Z)/20:0/0:0) + Gondoyl-CoA → TG(18:1(9Z)/20:0/20:1(11Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:0/0:0) + Docosanoyl-CoA → TG(18:1(9Z)/20:0/22:0) + Coenzyme Adetails
DG(18:1(9Z)/20:0/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:0/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:0/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(18:1(9Z)/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:1(9Z)/20:1(11Z)/22:0) + Coenzyme Adetails
DG(18:1(9Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:0/0:0) + Docosanoyl-CoA → TG(18:1(9Z)/22:0/22:0) + Coenzyme Adetails
DG(18:1(9Z)/22:0/0:0) + Erucoyl-CoA → TG(18:1(9Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:0/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(18:1(9Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:2(9Z,12Z)/18:2(9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:2(9Z,12Z)/18:2(9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:2(9Z,12Z)/18:2(9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:2(9Z,12Z)/18:2(9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:2(9Z,12Z)/18:2(9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/20:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/20:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(11Z))[iso6] + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:0/0:0) + Eicosanoyl-CoA → TG(18:2(9Z,12Z)/20:0/20:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:0/0:0) + Gondoyl-CoA → TG(18:2(9Z,12Z)/20:0/20:1(11Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:0/0:0) + Docosanoyl-CoA → TG(18:2(9Z,12Z)/20:0/22:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:0/0:0) + Erucoyl-CoA → TG(18:2(9Z,12Z)/20:0/22:1(13Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:0/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(18:2(9Z,12Z)/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:2(9Z,12Z)/20:1(11Z)/22:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(18:2(9Z,12Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:0/0:0) + Docosanoyl-CoA → TG(18:2(9Z,12Z)/22:0/22:0) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:0/0:0) + Erucoyl-CoA → TG(18:2(9Z,12Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:0/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(18:2(9Z,12Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/20:0)[iso3] + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/22:0) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/20:0)[iso6] + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:0/0:0) + Eicosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/20:0/20:0) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:0/0:0) + Gondoyl-CoA → TG(18:3(6Z,9Z,12Z)/20:0/20:1(11Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:0/0:0) + Docosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/20:0/22:0) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:0/0:0) + Erucoyl-CoA → TG(18:3(6Z,9Z,12Z)/20:0/22:1(13Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:0/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(18:3(6Z,9Z,12Z)/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/20:1(11Z)/22:0) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(18:3(6Z,9Z,12Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:0/0:0) + Docosanoyl-CoA → TG(18:3(6Z,9Z,12Z)/22:0/22:0) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:0/0:0) + Erucoyl-CoA → TG(18:3(6Z,9Z,12Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:0/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(18:3(6Z,9Z,12Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/20:0)[iso3] + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/22:0) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:0/0:0) + Eicosanoyl-CoA → TG(18:3(9Z,12Z,15Z)/20:0/20:0) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:0/0:0) + Docosanoyl-CoA → TG(18:3(9Z,12Z,15Z)/20:0/22:0) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:0/0:0) + Erucoyl-CoA → TG(18:3(9Z,12Z,15Z)/20:0/22:1(13Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:0/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(18:3(9Z,12Z,15Z)/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(18:3(9Z,12Z,15Z)/20:1(11Z)/22:0) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(18:3(9Z,12Z,15Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/18:3(9Z,12Z,15Z))[iso3] + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:0/0:0) + Docosanoyl-CoA → TG(18:3(9Z,12Z,15Z)/22:0/22:0) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:0/0:0) + Erucoyl-CoA → TG(18:3(9Z,12Z,15Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:0/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(18:3(9Z,12Z,15Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:0/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/22:0/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/20:0/0:0) + Eicosanoyl-CoA → TG(20:0/20:0/20:0) + Coenzyme Adetails
DG(20:0/20:0/0:0) + Gondoyl-CoA → TG(20:0/20:0/20:1(11Z)) + Coenzyme Adetails
DG(20:0/20:0/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:0/20:0/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:0/20:0/0:0) + Docosanoyl-CoA → TG(20:0/20:0/22:0) + Coenzyme Adetails
DG(20:0/20:0/0:0) + Erucoyl-CoA → TG(20:0/20:0/22:1(13Z)) + Coenzyme Adetails
DG(20:0/20:1(11Z)/0:0) + Gondoyl-CoA → TG(20:0/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(20:0/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:0/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:0/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(20:0/20:1(11Z)/22:0) + Coenzyme Adetails
DG(20:0/20:1(11Z)/0:0) + Erucoyl-CoA → TG(20:0/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:0/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:0/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:0/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Docosanoyl-CoA → TG(20:0/20:4(5Z,8Z,11Z,14Z)/22:0) + Coenzyme Adetails
DG(20:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(20:0/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:0/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/20:4(5Z,8Z,11Z,14Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/20:4(5Z,8Z,11Z,14Z)/24:0) + Coenzyme Adetails
DG(20:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(20:0/20:4(8Z,11Z,14Z,17Z)/22:0) + Coenzyme Adetails
DG(20:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(20:0/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:0/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/20:4(8Z,11Z,14Z,17Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/20:4(8Z,11Z,14Z,17Z)/24:0) + Coenzyme Adetails
DG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Docosanoyl-CoA → TG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:0) + Coenzyme Adetails
DG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/24:0) + Coenzyme Adetails
DG(20:0/22:0/0:0) + Docosanoyl-CoA → TG(20:0/22:0/22:0) + Coenzyme Adetails
DG(20:0/22:0/0:0) + Erucoyl-CoA → TG(20:0/22:0/22:1(13Z)) + Coenzyme Adetails
DG(20:0/22:1(13Z)/0:0) + Erucoyl-CoA → TG(20:0/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:0/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:0/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/22:2(13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/22:2(13Z,16Z)/24:0) + Coenzyme Adetails
DG(20:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:0/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/22:4(7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(20:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:0/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/22:5(4Z,7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(20:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:0/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/22:5(7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(20:1(11Z)/20:1(11Z)/0:0) + Gondoyl-CoA → TG(20:1(11Z)/20:1(11Z)/20:1(11Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:1(11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:1(11Z)/20:1(11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:1(11Z)/0:0) + Docosanoyl-CoA → TG(20:1(11Z)/20:1(11Z)/22:0) + Coenzyme Adetails
DG(20:1(11Z)/20:1(11Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/20:1(11Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:1(11Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:1(11Z)/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:2(11Z,14Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/20:2n6/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:1(11Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:1(11Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:0/0:0) + Docosanoyl-CoA → TG(20:1(11Z)/22:0/22:0) + Coenzyme Adetails
DG(20:1(11Z)/22:0/0:0) + Erucoyl-CoA → TG(20:1(11Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:0/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(20:1(11Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:2(11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:2n6/20:2n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:2(11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:2n6/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:2n6/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:2n6/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/22:0/0:0) + Clupanodonyl CoA → TG(20:2n6/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:2n6/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)/0:0) + Erucoyl-CoA → TG(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:3(5Z,8Z,11Z)/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(20:3(5Z,8Z,11Z)/20:3n6/22:1(13Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Erucoyl-CoA → TG(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Erucoyl-CoA → TG(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:0/0:0) + Erucoyl-CoA → TG(20:3(5Z,8Z,11Z)/22:0/22:1(13Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:0/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(20:3(5Z,8Z,11Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:3n6/20:3n6/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:3n6/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/22:0/0:0) + Clupanodonyl CoA → TG(20:3n6/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:3n6/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + 5Z,8Z,11Z,14Z-eicosatetraenonyl-CoA → TG(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/22:0/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/22:0/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) + Clupanodonyl CoA → TG(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:0/0:0) + Clupanodonyl CoA → TG(20:5(5Z,8Z,11Z,14Z,17Z)/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:0/22:0/0:0) + Docosanoyl-CoA → TG(22:0/22:0/22:0) + Coenzyme Adetails
DG(22:0/22:0/0:0) + Erucoyl-CoA → TG(22:0/22:0/22:1(13Z)) + Coenzyme Adetails
DG(22:0/22:0/0:0) + Clupanodonyl CoA → TG(22:0/22:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:0/22:0/0:0) + Tetracosanoyl-CoA → TG(22:0/22:0/24:0) + Coenzyme Adetails
DG(22:0/22:1(13Z)/0:0) + Erucoyl-CoA → TG(22:0/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(22:0/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(22:0/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:0/22:1(13Z)/0:0) + Tetracosanoyl-CoA → TG(22:0/22:1(13Z)/24:0) + Coenzyme Adetails
DG(22:0/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:0/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:0/22:2(13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(22:0/22:2(13Z,16Z)/24:0) + Coenzyme Adetails
DG(22:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:0/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:0/22:4(7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(22:0/22:4(7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(22:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:0/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Tetracosanoyl-CoA → TG(22:0/22:5(4Z,7Z,10Z,13Z,16Z)/24:0) + Coenzyme Adetails
DG(22:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(22:0/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(22:0/22:5(7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) + Tetracosanoyl-CoA → TG(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0) + Coenzyme Adetails
DG(22:0/24:0/0:0) + Tetracosanoyl-CoA → TG(22:0/24:0/24:0) + Coenzyme Adetails
DG(22:1(13Z)/22:1(13Z)/0:0) + Erucoyl-CoA → TG(22:1(13Z)/22:1(13Z)/22:1(13Z)) + Coenzyme Adetails
DG(22:1(13Z)/22:1(13Z)/0:0) + Clupanodonyl CoA → TG(22:1(13Z)/22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:1(13Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:1(13Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:2(13Z,16Z)/22:2(13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:2(13Z,16Z)/22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:2(13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) + Clupanodonyl CoA → TG(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) + Clupanodonyl CoA → TG(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) + Coenzyme Adetails
DG(24:0/24:0/0:0) + Tetracosanoyl-CoA → TG(24:0/24:0/24:0) + Coenzyme Adetails
Vitamin A + Acetyl-CoA → Retinyl ester + Coenzyme Adetails
DG(19:0/21:0/0:0) + Lauroyl-CoA → TG(19:0/21:0/12:0) + Coenzyme Adetails
DG(20:0/13:0/0:0) + Palmityl-CoA → TG(20:0/13:0/16:0) + Coenzyme Adetails
DG(20:0/14:0/0:0) + Lauroyl-CoA → TG(20:0/14:0/12:0) + Coenzyme Adetails
DG(20:0/17:0/0:0) + Heptadecanoyl CoA → TG(20:0/17:0/17:0) + Coenzyme Adetails
DG(20:0/19:0/0:0) + Stearoyl-CoA → TG(20:0/19:0/18:0) + Coenzyme Adetails
DG(20:0/10:0/0:0) + Docosanoyl-CoA → TG(20:0/10:0/22:0) + Coenzyme Adetails
DG(20:0/8:0/0:0) + Docosanoyl-CoA → TG(20:0/8:0/22:0) + Coenzyme Adetails
DG(19:0/22:0/0:0) + Lauroyl-CoA → TG(19:0/22:0/12:0) + Coenzyme Adetails
DG(19:0/22:0/0:0) + Docosanoyl-CoA → TG(19:0/22:0/22:0) + Coenzyme Adetails
DG(20:0/18:0/0:0) + Heptadecanoyl CoA → TG(20:0/18:0/17:0) + Coenzyme Adetails
DG(20:0/8:0/0:0) + Palmityl-CoA → TG(20:0/8:0/16:0) + Coenzyme Adetails
DG(19:0/22:0/0:0) + Stearoyl-CoA → TG(19:0/22:0/18:0) + Coenzyme Adetails
DG(20:0/13:0/0:0) + Docosanoyl-CoA → TG(20:0/13:0/22:0) + Coenzyme Adetails
DG(20:0/15:0/0:0) + Heptadecanoyl CoA → TG(20:0/15:0/17:0) + Coenzyme Adetails
DG(19:0/22:0/0:0) + Tridecanoyl-CoA → TG(19:0/22:0/13:0) + Coenzyme Adetails
DG(20:0/17:0/0:0) + Tridecanoyl-CoA → TG(20:0/17:0/13:0) + Coenzyme Adetails
DG(20:0/19:0/0:0) + Tridecanoyl-CoA → TG(20:0/19:0/13:0) + Coenzyme Adetails
DG(19:0/21:0/0:0) + Heptadecanoyl CoA → TG(19:0/21:0/17:0) + Coenzyme Adetails
DG(20:0/12:0/0:0) + Palmityl-CoA → TG(20:0/12:0/16:0) + Coenzyme Adetails
DG(20:0/17:0/0:0) + Docosanoyl-CoA → TG(20:0/17:0/22:0) + Coenzyme Adetails
DG(20:0/14:0/0:0) + Tridecanoyl-CoA → TG(20:0/14:0/13:0) + Coenzyme Adetails
DG(20:0/12:0/0:0) + Stearoyl-CoA → TG(20:0/12:0/18:0) + Coenzyme Adetails
DG(19:0/22:0/0:0) + Palmityl-CoA → TG(19:0/22:0/16:0) + Coenzyme Adetails
DG(20:0/17:0/0:0) + Palmityl-CoA → TG(20:0/17:0/16:0) + Coenzyme Adetails
DG(20:0/20:0/0:0) + Heptadecanoyl CoA → TG(20:0/20:0/17:0) + Coenzyme Adetails
DG(20:0/12:0/0:0) + Heptadecanoyl CoA → TG(20:0/12:0/17:0) + Coenzyme Adetails
DG(20:0/18:0/0:0) + Tridecanoyl-CoA → TG(20:0/18:0/13:0) + Coenzyme Adetails
DG(19:0/22:0/0:0) + Heptadecanoyl CoA → TG(19:0/22:0/17:0) + Coenzyme Adetails
DG(19:0/20:0/0:0) + Docosanoyl-CoA → TG(19:0/20:0/22:0) + Coenzyme Adetails
DG(20:0/10:0/0:0) + Heptadecanoyl CoA → TG(20:0/10:0/17:0) + Coenzyme Adetails
DG(20:0/12:0/0:0) + Docosanoyl-CoA → TG(20:0/12:0/22:0) + Coenzyme Adetails
DG(19:0/21:0/0:0) + Docosanoyl-CoA → TG(19:0/21:0/22:0) + Coenzyme Adetails
DG(19:0/21:0/0:0) + Tridecanoyl-CoA → TG(19:0/21:0/13:0) + Coenzyme Adetails
DG(20:0/12:0/0:0) + Tridecanoyl-CoA → TG(20:0/12:0/13:0) + Coenzyme Adetails
DG(20:0/15:0/0:0) + Lauroyl-CoA → TG(20:0/15:0/12:0) + Coenzyme Adetails
DG(20:0/13:0/0:0) + Tridecanoyl-CoA → TG(20:0/13:0/13:0) + Coenzyme Adetails
DG(19:0/21:0/0:0) + Stearoyl-CoA → TG(19:0/21:0/18:0) + Coenzyme Adetails
DG(20:0/20:0/0:0) + Tridecanoyl-CoA → TG(20:0/20:0/13:0) + Coenzyme Adetails
DG(20:0/12:0/0:0) + Lauroyl-CoA → TG(20:0/12:0/12:0) + Coenzyme Adetails
DG(19:0/21:0/0:0) + Palmityl-CoA → TG(19:0/21:0/16:0) + Coenzyme Adetails
DG(20:0/20:0/0:0) + Lauroyl-CoA → TG(20:0/20:0/12:0) + Coenzyme Adetails
DG(21:0/14:0/0:0) + Docosanoyl-CoA → TG(21:0/14:0/22:0) + Coenzyme Adetails
DG(21:0/10:0/0:0) + Stearoyl-CoA → TG(21:0/10:0/18:0) + Coenzyme Adetails
DG(21:0/10:0/0:0) + Tridecanoyl-CoA → TG(21:0/10:0/13:0) + Coenzyme Adetails
DG(21:0/13:0/0:0) + Stearoyl-CoA → TG(21:0/13:0/18:0) + Coenzyme Adetails
DG(21:0/14:0/0:0) + Tridecanoyl-CoA → TG(21:0/14:0/13:0) + Coenzyme Adetails
DG(21:0/13:0/0:0) + Heptadecanoyl CoA → TG(21:0/13:0/17:0) + Coenzyme Adetails
DG(21:0/14:0/0:0) + Palmityl-CoA → TG(21:0/14:0/16:0) + Coenzyme Adetails
DG(21:0/10:0/0:0) + Heptadecanoyl CoA → TG(21:0/10:0/17:0) + Coenzyme Adetails
DG(21:0/12:0/0:0) + Tridecanoyl-CoA → TG(21:0/12:0/13:0) + Coenzyme Adetails
DG(21:0/14:0/0:0) + Heptadecanoyl CoA → TG(21:0/14:0/17:0) + Coenzyme Adetails
DG(21:0/8:0/0:0) + Tridecanoyl-CoA → TG(21:0/8:0/13:0) + Coenzyme Adetails
DG(21:0/16:0/0:0) + Stearoyl-CoA → TG(21:0/16:0/18:0) + Coenzyme Adetails
DG(21:0/8:0/0:0) + Lauroyl-CoA → TG(21:0/8:0/12:0) + Coenzyme Adetails
DG(21:0/15:0/0:0) + Tridecanoyl-CoA → TG(21:0/15:0/13:0) + Coenzyme Adetails
DG(21:0/8:0/0:0) + Palmityl-CoA → TG(21:0/8:0/16:0) + Coenzyme Adetails
DG(21:0/12:0/0:0) + Lauroyl-CoA → TG(21:0/12:0/12:0) + Coenzyme Adetails
DG(21:0/8:0/0:0) + Docosanoyl-CoA → TG(21:0/8:0/22:0) + Coenzyme Adetails
DG(21:0/10:0/0:0) + Lauroyl-CoA → TG(21:0/10:0/12:0) + Coenzyme Adetails
DG(21:0/16:0/0:0) + Heptadecanoyl CoA → TG(21:0/16:0/17:0) + Coenzyme Adetails
DG(21:0/12:0/0:0) + Docosanoyl-CoA → TG(21:0/12:0/22:0) + Coenzyme Adetails
DG(21:0/10:0/0:0) + Docosanoyl-CoA → TG(21:0/10:0/22:0) + Coenzyme Adetails
DG(21:0/13:0/0:0) + Tridecanoyl-CoA → TG(21:0/13:0/13:0) + Coenzyme Adetails
DG(21:0/15:0/0:0) + Stearoyl-CoA → TG(21:0/15:0/18:0) + Coenzyme Adetails
DG(20:0/21:0/0:0) + Docosanoyl-CoA → TG(20:0/21:0/22:0) + Coenzyme Adetails
DG(21:0/17:0/0:0) + Lauroyl-CoA → TG(21:0/17:0/12:0) + Coenzyme Adetails
DG(21:0/8:0/0:0) + Stearoyl-CoA → TG(21:0/8:0/18:0) + Coenzyme Adetails
DG(21:0/13:0/0:0) + Palmityl-CoA → TG(21:0/13:0/16:0) + Coenzyme Adetails
DG(21:0/16:0/0:0) + Palmityl-CoA → TG(21:0/16:0/16:0) + Coenzyme Adetails
DG(21:0/12:0/0:0) + Palmityl-CoA → TG(21:0/12:0/16:0) + Coenzyme Adetails
DG(21:0/15:0/0:0) + Heptadecanoyl CoA → TG(21:0/15:0/17:0) + Coenzyme Adetails
DG(21:0/16:0/0:0) + Docosanoyl-CoA → TG(21:0/16:0/22:0) + Coenzyme Adetails
DG(21:0/14:0/0:0) + Stearoyl-CoA → TG(21:0/14:0/18:0) + Coenzyme Adetails
DG(21:0/12:0/0:0) + Stearoyl-CoA → TG(21:0/12:0/18:0) + Coenzyme Adetails
DG(21:0/13:0/0:0) + Docosanoyl-CoA → TG(21:0/13:0/22:0) + Coenzyme Adetails
DG(21:0/15:0/0:0) + Docosanoyl-CoA → TG(21:0/15:0/22:0) + Coenzyme Adetails
DG(21:0/17:0/0:0) + Heptadecanoyl CoA → TG(21:0/17:0/17:0) + Coenzyme Adetails
DG(21:0/22:0/0:0) + Stearoyl-CoA → TG(21:0/22:0/18:0) + Coenzyme Adetails
DG(21:0/22:0/0:0) + Heptadecanoyl CoA → TG(21:0/22:0/17:0) + Coenzyme Adetails
DG(21:0/18:0/0:0) + Heptadecanoyl CoA → TG(21:0/18:0/17:0) + Coenzyme Adetails
DG(21:0/18:0/0:0) + Stearoyl-CoA → TG(21:0/18:0/18:0) + Coenzyme Adetails
DG(21:0/22:0/0:0) + Docosanoyl-CoA → TG(21:0/22:0/22:0) + Coenzyme Adetails
DG(22:0/17:0/0:0) + Lauroyl-CoA → TG(22:0/17:0/12:0) + Coenzyme Adetails
DG(22:0/12:0/0:0) + Tridecanoyl-CoA → TG(22:0/12:0/13:0) + Coenzyme Adetails
DG(22:0/12:0/0:0) + Lauroyl-CoA → TG(22:0/12:0/12:0) + Coenzyme Adetails
DG(22:0/16:0/0:0) + Lauroyl-CoA → TG(22:0/16:0/12:0) + Coenzyme Adetails
DG(22:0/12:0/0:0) + Stearoyl-CoA → TG(22:0/12:0/18:0) + Coenzyme Adetails
DG(22:0/10:0/0:0) + Lauroyl-CoA → TG(22:0/10:0/12:0) + Coenzyme Adetails
DG(22:0/17:0/0:0) + Palmityl-CoA → TG(22:0/17:0/16:0) + Coenzyme Adetails
DG(22:0/13:0/0:0) + Stearoyl-CoA → TG(22:0/13:0/18:0) + Coenzyme Adetails
DG(22:0/18:0/0:0) + Heptadecanoyl CoA → TG(22:0/18:0/17:0) + Coenzyme Adetails
DG(22:0/13:0/0:0) + Heptadecanoyl CoA → TG(22:0/13:0/17:0) + Coenzyme Adetails
DG(22:0/14:0/0:0) + Tridecanoyl-CoA → TG(22:0/14:0/13:0) + Coenzyme Adetails
DG(22:0/10:0/0:0) + Tridecanoyl-CoA → TG(22:0/10:0/13:0) + Coenzyme Adetails
DG(22:0/8:0/0:0) + Palmityl-CoA → TG(22:0/8:0/16:0) + Coenzyme Adetails
DG(22:0/13:0/0:0) + Palmityl-CoA → TG(22:0/13:0/16:0) + Coenzyme Adetails
DG(22:0/17:0/0:0) + Heptadecanoyl CoA → TG(22:0/17:0/17:0) + Coenzyme Adetails
DG(22:0/22:0/0:0) + Tridecanoyl-CoA → TG(22:0/22:0/13:0) + Coenzyme Adetails
DG(22:0/22:0/0:0) + Lauroyl-CoA → TG(22:0/22:0/12:0) + Coenzyme Adetails
DG(22:0/13:0/0:0) + Tridecanoyl-CoA → TG(22:0/13:0/13:0) + Coenzyme Adetails
DG(22:0/22:0/0:0) + Heptadecanoyl CoA → TG(22:0/22:0/17:0) + Coenzyme Adetails
DG(8:0/19:0/0:0) + Lauroyl-CoA → TG(8:0/19:0/12:0) + Coenzyme Adetails
DG(10:0/18:0/0:0) + Stearoyl-CoA → TG(10:0/18:0/18:0) + Coenzyme Adetails
DG(8:0/12:0/0:0) + Palmityl-CoA → TG(8:0/12:0/16:0) + Coenzyme Adetails
DG(10:0/18:0/0:0) + Heptadecanoyl CoA → TG(10:0/18:0/17:0) + Coenzyme Adetails
DG(8:0/18:0/0:0) + Heptadecanoyl CoA → TG(8:0/18:0/17:0) + Coenzyme Adetails
DG(10:0/17:0/0:0) + Tridecanoyl-CoA → TG(10:0/17:0/13:0) + Coenzyme Adetails
DG(10:0/8:0/0:0) + Heptadecanoyl CoA → TG(10:0/8:0/17:0) + Coenzyme Adetails
DG(10:0/16:0/0:0) + Heptadecanoyl CoA → TG(10:0/16:0/17:0) + Coenzyme Adetails
DG(8:0/13:0/0:0) + Lauroyl-CoA → TG(8:0/13:0/12:0) + Coenzyme Adetails
DG(10:0/13:0/0:0) + Tridecanoyl-CoA → TG(10:0/13:0/13:0) + Coenzyme Adetails
DG(10:0/15:0/0:0) + Heptadecanoyl CoA → TG(10:0/15:0/17:0) + Coenzyme Adetails
DG(10:0/13:0/0:0) + Palmityl-CoA → TG(10:0/13:0/16:0) + Coenzyme Adetails
DG(8:0/13:0/0:0) + Heptadecanoyl CoA → TG(8:0/13:0/17:0) + Coenzyme Adetails
DG(10:0/17:0/0:0) + Lauroyl-CoA → TG(10:0/17:0/12:0) + Coenzyme Adetails
DG(10:0/16:0/0:0) + Palmityl-CoA → TG(10:0/16:0/16:0) + Coenzyme Adetails
DG(10:0/12:0/0:0) + Lauroyl-CoA → TG(10:0/12:0/12:0) + Coenzyme Adetails
DG(10:0/19:0/0:0) + Tridecanoyl-CoA → TG(10:0/19:0/13:0) + Coenzyme Adetails
DG(8:0/16:0/0:0) + Stearoyl-CoA → TG(8:0/16:0/18:0) + Coenzyme Adetails
DG(8:0/14:0/0:0) + Lauroyl-CoA → TG(8:0/14:0/12:0) + Coenzyme Adetails
DG(10:0/16:0/0:0) + Lauroyl-CoA → TG(10:0/16:0/12:0) + Coenzyme Adetails
DG(8:0/19:0/0:0) + Heptadecanoyl CoA → TG(8:0/19:0/17:0) + Coenzyme Adetails
DG(8:0/15:0/0:0) + Lauroyl-CoA → TG(8:0/15:0/12:0) + Coenzyme Adetails
DG(10:0/14:0/0:0) + Heptadecanoyl CoA → TG(10:0/14:0/17:0) + Coenzyme Adetails
DG(10:0/14:0/0:0) + Stearoyl-CoA → TG(10:0/14:0/18:0) + Coenzyme Adetails
DG(8:0/14:0/0:0) + Heptadecanoyl CoA → TG(8:0/14:0/17:0) + Coenzyme Adetails
DG(10:0/18:0/0:0) + Tridecanoyl-CoA → TG(10:0/18:0/13:0) + Coenzyme Adetails
DG(10:0/18:0/0:0) + Lauroyl-CoA → TG(10:0/18:0/12:0) + Coenzyme Adetails
DG(10:0/19:0/0:0) + Palmityl-CoA → TG(10:0/19:0/16:0) + Coenzyme Adetails
DG(8:0/13:0/0:0) + Tridecanoyl-CoA → TG(8:0/13:0/13:0) + Coenzyme Adetails
DG(8:0/16:0/0:0) + Palmityl-CoA → TG(8:0/16:0/16:0) + Coenzyme Adetails
DG(8:0/12:0/0:0) + Lauroyl-CoA → TG(8:0/12:0/12:0) + Coenzyme Adetails
DG(8:0/15:0/0:0) + Heptadecanoyl CoA → TG(8:0/15:0/17:0) + Coenzyme Adetails
DG(10:0/17:0/0:0) + Heptadecanoyl CoA → TG(10:0/17:0/17:0) + Coenzyme Adetails
DG(8:0/17:0/0:0) + Heptadecanoyl CoA → TG(8:0/17:0/17:0) + Coenzyme Adetails
DG(8:0/14:0/0:0) + Stearoyl-CoA → TG(8:0/14:0/18:0) + Coenzyme Adetails
DG(10:0/19:0/0:0) + Lauroyl-CoA → TG(10:0/19:0/12:0) + Coenzyme Adetails
DG(10:0/12:0/0:0) + Tridecanoyl-CoA → TG(10:0/12:0/13:0) + Coenzyme Adetails
DG(8:0/16:0/0:0) + Tridecanoyl-CoA → TG(8:0/16:0/13:0) + Coenzyme Adetails
DG(8:0/17:0/0:0) + Lauroyl-CoA → TG(8:0/17:0/12:0) + Coenzyme Adetails
DG(10:0/16:0/0:0) + Stearoyl-CoA → TG(10:0/16:0/18:0) + Coenzyme Adetails
DG(8:0/18:0/0:0) + Stearoyl-CoA → TG(8:0/18:0/18:0) + Coenzyme Adetails
DG(10:0/19:0/0:0) + Heptadecanoyl CoA → TG(10:0/19:0/17:0) + Coenzyme Adetails
DG(10:0/15:0/0:0) + Stearoyl-CoA → TG(10:0/15:0/18:0) + Coenzyme Adetails
DG(8:0/18:0/0:0) + Tridecanoyl-CoA → TG(8:0/18:0/13:0) + Coenzyme Adetails
DG(8:0/17:0/0:0) + Palmityl-CoA → TG(8:0/17:0/16:0) + Coenzyme Adetails
DG(8:0/19:0/0:0) + Stearoyl-CoA → TG(8:0/19:0/18:0) + Coenzyme Adetails
DG(10:0/14:0/0:0) + Tridecanoyl-CoA → TG(10:0/14:0/13:0) + Coenzyme Adetails
DG(8:0/12:0/0:0) + Stearoyl-CoA → TG(8:0/12:0/18:0) + Coenzyme Adetails
DG(19:0/a-21:0/0:0) + Lauroyl-CoA → TG(19:0/a-21:0/12:0) + Coenzyme Adetails
DG(19:0/a-21:0/0:0) + Tridecanoyl-CoA → TG(19:0/a-21:0/13:0) + Coenzyme Adetails
DG(19:0/a-21:0/0:0) + Palmityl-CoA → TG(19:0/a-21:0/16:0) + Coenzyme Adetails
DG(19:0/a-21:0/0:0) + Heptadecanoyl CoA → TG(19:0/a-21:0/17:0) + Coenzyme Adetails
DG(19:0/a-21:0/0:0) + Stearoyl-CoA → TG(19:0/a-21:0/18:0) + Coenzyme Adetails
DG(19:0/a-25:0/0:0) + Lauroyl-CoA → TG(19:0/a-25:0/12:0) + Coenzyme Adetails
DG(19:0/a-25:0/0:0) + Tridecanoyl-CoA → TG(19:0/a-25:0/13:0) + Coenzyme Adetails
DG(19:0/a-25:0/0:0) + Palmityl-CoA → TG(19:0/a-25:0/16:0) + Coenzyme Adetails
DG(19:0/a-25:0/0:0) + Heptadecanoyl CoA → TG(19:0/a-25:0/17:0) + Coenzyme Adetails
DG(19:0/a-25:0/0:0) + Stearoyl-CoA → TG(19:0/a-25:0/18:0) + Coenzyme Adetails
DG(19:0/i-21:0/0:0) + Lauroyl-CoA → TG(19:0/i-21:0/12:0) + Coenzyme Adetails
DG(19:0/i-21:0/0:0) + Tridecanoyl-CoA → TG(19:0/i-21:0/13:0) + Coenzyme Adetails
DG(19:0/i-21:0/0:0) + Palmityl-CoA → TG(19:0/i-21:0/16:0) + Coenzyme Adetails
DG(19:0/i-21:0/0:0) + Heptadecanoyl CoA → TG(19:0/i-21:0/17:0) + Coenzyme Adetails
DG(19:0/i-21:0/0:0) + Stearoyl-CoA → TG(19:0/i-21:0/18:0) + Coenzyme Adetails
DG(19:0/i-22:0/0:0) + Lauroyl-CoA → TG(19:0/i-22:0/12:0) + Coenzyme Adetails
DG(19:0/i-22:0/0:0) + Tridecanoyl-CoA → TG(19:0/i-22:0/13:0) + Coenzyme Adetails
DG(19:0/i-22:0/0:0) + Palmityl-CoA → TG(19:0/i-22:0/16:0) + Coenzyme Adetails
DG(19:0/i-22:0/0:0) + Heptadecanoyl CoA → TG(19:0/i-22:0/17:0) + Coenzyme Adetails
DG(19:0/i-22:0/0:0) + Stearoyl-CoA → TG(19:0/i-22:0/18:0) + Coenzyme Adetails
DG(19:0/i-24:0/0:0) + Lauroyl-CoA → TG(19:0/i-24:0/12:0) + Coenzyme Adetails
DG(19:0/i-24:0/0:0) + Tridecanoyl-CoA → TG(19:0/i-24:0/13:0) + Coenzyme Adetails
DG(19:0/i-24:0/0:0) + Palmityl-CoA → TG(19:0/i-24:0/16:0) + Coenzyme Adetails
DG(19:0/i-24:0/0:0) + Heptadecanoyl CoA → TG(19:0/i-24:0/17:0) + Coenzyme Adetails
DG(19:0/i-24:0/0:0) + Stearoyl-CoA → TG(19:0/i-24:0/18:0) + Coenzyme Adetails
DG(20:0/a-21:0/0:0) + Lauroyl-CoA → TG(20:0/a-21:0/12:0)[rac] + Coenzyme Adetails
DG(a-21:0/12:0/0:0) + Lauroyl-CoA → TG(a-21:0/12:0/12:0)[rac] + Coenzyme Adetails
DG(a-21:0/12:0/0:0) + Tridecanoyl-CoA → TG(a-21:0/12:0/13:0)[rac] + Coenzyme Adetails
DG(a-21:0/12:0/0:0) + Palmityl-CoA → TG(a-21:0/12:0/16:0)[rac] + Coenzyme Adetails
DG(a-21:0/12:0/0:0) + Heptadecanoyl CoA → TG(a-21:0/12:0/17:0)[rac] + Coenzyme Adetails
DG(a-21:0/12:0/0:0) + Stearoyl-CoA → TG(a-21:0/12:0/18:0)[rac] + Coenzyme Adetails
DG(a-21:0/13:0/0:0) + Tridecanoyl-CoA → TG(a-21:0/13:0/13:0)[rac] + Coenzyme Adetails
DG(a-21:0/13:0/0:0) + Palmityl-CoA → TG(a-21:0/13:0/16:0)[rac] + Coenzyme Adetails
DG(a-21:0/13:0/0:0) + Heptadecanoyl CoA → TG(a-21:0/13:0/17:0)[rac] + Coenzyme Adetails
DG(a-21:0/13:0/0:0) + Stearoyl-CoA → TG(a-21:0/13:0/18:0)[rac] + Coenzyme Adetails
DG(a-21:0/14:0/0:0) + Palmityl-CoA → TG(a-21:0/14:0/16:0)[rac] + Coenzyme Adetails
DG(a-21:0/14:0/0:0) + Heptadecanoyl CoA → TG(a-21:0/14:0/17:0)[rac] + Coenzyme Adetails
DG(a-21:0/14:0/0:0) + Stearoyl-CoA → TG(a-21:0/14:0/18:0)[rac] + Coenzyme Adetails
DG(a-21:0/15:0/0:0) + Palmityl-CoA → TG(a-21:0/15:0/16:0)[rac] + Coenzyme Adetails
DG(a-21:0/15:0/0:0) + Heptadecanoyl CoA → TG(a-21:0/15:0/17:0)[rac] + Coenzyme Adetails
DG(a-21:0/15:0/0:0) + Stearoyl-CoA → TG(a-21:0/15:0/18:0)[rac] + Coenzyme Adetails
DG(a-21:0/16:0/0:0) + Palmityl-CoA → TG(a-21:0/16:0/16:0)[rac] + Coenzyme Adetails
DG(a-21:0/16:0/0:0) + Heptadecanoyl CoA → TG(a-21:0/16:0/17:0)[rac] + Coenzyme Adetails
DG(a-21:0/16:0/0:0) + Stearoyl-CoA → TG(a-21:0/16:0/18:0)[rac] + Coenzyme Adetails
DG(a-21:0/17:0/0:0) + Heptadecanoyl CoA → TG(a-21:0/17:0/17:0)[rac] + Coenzyme Adetails
DG(a-21:0/17:0/0:0) + Stearoyl-CoA → TG(a-21:0/17:0/18:0)[rac] + Coenzyme Adetails
DG(a-21:0/18:0/0:0) + Stearoyl-CoA → TG(a-21:0/18:0/18:0)[rac] + Coenzyme Adetails
DG(a-21:0/a-21:0/0:0) + Lauroyl-CoA → TG(a-21:0/a-21:0/12:0)[rac] + Coenzyme Adetails
DG(a-21:0/a-21:0/0:0) + Tridecanoyl-CoA → TG(a-21:0/a-21:0/13:0)[rac] + Coenzyme Adetails
DG(a-21:0/a-21:0/0:0) + Palmityl-CoA → TG(a-21:0/a-21:0/16:0)[rac] + Coenzyme Adetails
DG(a-21:0/a-21:0/0:0) + Heptadecanoyl CoA → TG(a-21:0/a-21:0/17:0)[rac] + Coenzyme Adetails
DG(a-21:0/a-21:0/0:0) + Stearoyl-CoA → TG(a-21:0/a-21:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/12:0/0:0) + Lauroyl-CoA → TG(a-25:0/12:0/12:0)[rac] + Coenzyme Adetails
DG(a-25:0/12:0/0:0) + Tridecanoyl-CoA → TG(a-25:0/12:0/13:0)[rac] + Coenzyme Adetails
DG(a-25:0/12:0/0:0) + Palmityl-CoA → TG(a-25:0/12:0/16:0)[rac] + Coenzyme Adetails
DG(a-25:0/12:0/0:0) + Heptadecanoyl CoA → TG(a-25:0/12:0/17:0)[rac] + Coenzyme Adetails
DG(a-25:0/12:0/0:0) + Stearoyl-CoA → TG(a-25:0/12:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/13:0/0:0) + Tridecanoyl-CoA → TG(a-25:0/13:0/13:0)[rac] + Coenzyme Adetails
DG(a-25:0/13:0/0:0) + Palmityl-CoA → TG(a-25:0/13:0/16:0)[rac] + Coenzyme Adetails
DG(a-25:0/13:0/0:0) + Heptadecanoyl CoA → TG(a-25:0/13:0/17:0)[rac] + Coenzyme Adetails
DG(a-25:0/13:0/0:0) + Stearoyl-CoA → TG(a-25:0/13:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/14:0/0:0) + Palmityl-CoA → TG(a-25:0/14:0/16:0)[rac] + Coenzyme Adetails
DG(a-25:0/14:0/0:0) + Heptadecanoyl CoA → TG(a-25:0/14:0/17:0)[rac] + Coenzyme Adetails
DG(a-25:0/14:0/0:0) + Stearoyl-CoA → TG(a-25:0/14:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/15:0/0:0) + Palmityl-CoA → TG(a-25:0/15:0/16:0)[rac] + Coenzyme Adetails
DG(a-25:0/15:0/0:0) + Heptadecanoyl CoA → TG(a-25:0/15:0/17:0)[rac] + Coenzyme Adetails
DG(a-25:0/15:0/0:0) + Stearoyl-CoA → TG(a-25:0/15:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/16:0/0:0) + Palmityl-CoA → TG(a-25:0/16:0/16:0)[rac] + Coenzyme Adetails
DG(a-25:0/16:0/0:0) + Heptadecanoyl CoA → TG(a-25:0/16:0/17:0)[rac] + Coenzyme Adetails
DG(a-25:0/16:0/0:0) + Stearoyl-CoA → TG(a-25:0/16:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/17:0/0:0) + Heptadecanoyl CoA → TG(a-25:0/17:0/17:0)[rac] + Coenzyme Adetails
DG(a-25:0/17:0/0:0) + Stearoyl-CoA → TG(a-25:0/17:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/18:0/0:0) + Stearoyl-CoA → TG(a-25:0/18:0/18:0)[rac] + Coenzyme Adetails
DG(a-25:0/a-25:0/0:0) + Lauroyl-CoA → TG(a-25:0/a-25:0/12:0)[rac] + Coenzyme Adetails
DG(a-25:0/a-25:0/0:0) + Tridecanoyl-CoA → TG(a-25:0/a-25:0/13:0)[rac] + Coenzyme Adetails
DG(a-25:0/a-25:0/0:0) + Palmityl-CoA → TG(a-25:0/a-25:0/16:0)[rac] + Coenzyme Adetails
DG(a-25:0/a-25:0/0:0) + Heptadecanoyl CoA → TG(a-25:0/a-25:0/17:0)[rac] + Coenzyme Adetails
DG(a-25:0/a-25:0/0:0) + Stearoyl-CoA → TG(a-25:0/a-25:0/18:0)[rac] + Coenzyme Adetails
DG(i-19:0/i-21:0/0:0) + Lauroyl-CoA → TG(i-19:0/i-21:0/12:0) + Coenzyme Adetails
DG(i-19:0/i-21:0/0:0) + Tridecanoyl-CoA → TG(i-19:0/i-21:0/13:0) + Coenzyme Adetails
DG(i-19:0/i-21:0/0:0) + Palmityl-CoA → TG(i-19:0/i-21:0/16:0) + Coenzyme Adetails
DG(i-19:0/i-21:0/0:0) + Heptadecanoyl CoA → TG(i-19:0/i-21:0/17:0) + Coenzyme Adetails
DG(i-19:0/i-21:0/0:0) + Stearoyl-CoA → TG(i-19:0/i-21:0/18:0) + Coenzyme Adetails
DG(i-19:0/i-22:0/0:0) + Lauroyl-CoA → TG(i-19:0/i-22:0/12:0) + Coenzyme Adetails
DG(i-19:0/i-22:0/0:0) + Tridecanoyl-CoA → TG(i-19:0/i-22:0/13:0) + Coenzyme Adetails
DG(i-19:0/i-22:0/0:0) + Palmityl-CoA → TG(i-19:0/i-22:0/16:0) + Coenzyme Adetails
DG(i-19:0/i-22:0/0:0) + Heptadecanoyl CoA → TG(i-19:0/i-22:0/17:0) + Coenzyme Adetails
DG(i-19:0/i-22:0/0:0) + Stearoyl-CoA → TG(i-19:0/i-22:0/18:0) + Coenzyme Adetails
DG(i-19:0/i-24:0/0:0) + Lauroyl-CoA → TG(i-19:0/i-24:0/12:0) + Coenzyme Adetails
DG(i-19:0/i-24:0/0:0) + Tridecanoyl-CoA → TG(i-19:0/i-24:0/13:0) + Coenzyme Adetails
DG(i-19:0/i-24:0/0:0) + Palmityl-CoA → TG(i-19:0/i-24:0/16:0) + Coenzyme Adetails
DG(i-19:0/i-24:0/0:0) + Heptadecanoyl CoA → TG(i-19:0/i-24:0/17:0) + Coenzyme Adetails
DG(i-19:0/i-24:0/0:0) + Stearoyl-CoA → TG(i-19:0/i-24:0/18:0) + Coenzyme Adetails
DG(i-20:0/12:0/0:0) + Lauroyl-CoA → TG(i-20:0/12:0/12:0) + Coenzyme Adetails
DG(i-20:0/12:0/0:0) + Tridecanoyl-CoA → TG(i-20:0/12:0/13:0) + Coenzyme Adetails
DG(i-20:0/12:0/0:0) + Palmityl-CoA → TG(i-20:0/12:0/16:0) + Coenzyme Adetails
DG(i-20:0/12:0/0:0) + Heptadecanoyl CoA → TG(i-20:0/12:0/17:0) + Coenzyme Adetails
DG(i-20:0/12:0/0:0) + Stearoyl-CoA → TG(i-20:0/12:0/18:0) + Coenzyme Adetails
DG(i-20:0/13:0/0:0) + Tridecanoyl-CoA → TG(i-20:0/13:0/13:0) + Coenzyme Adetails
DG(i-20:0/13:0/0:0) + Palmityl-CoA → TG(i-20:0/13:0/16:0) + Coenzyme Adetails
DG(i-20:0/13:0/0:0) + Heptadecanoyl CoA → TG(i-20:0/13:0/17:0) + Coenzyme Adetails
DG(i-20:0/13:0/0:0) + Stearoyl-CoA → TG(i-20:0/13:0/18:0) + Coenzyme Adetails
DG(i-20:0/14:0/0:0) + Palmityl-CoA → TG(i-20:0/14:0/16:0) + Coenzyme Adetails
DG(i-20:0/14:0/0:0) + Heptadecanoyl CoA → TG(i-20:0/14:0/17:0) + Coenzyme Adetails
DG(i-20:0/14:0/0:0) + Stearoyl-CoA → TG(i-20:0/14:0/18:0) + Coenzyme Adetails
DG(i-20:0/15:0/0:0) + Palmityl-CoA → TG(i-20:0/15:0/16:0) + Coenzyme Adetails
DG(i-20:0/15:0/0:0) + Heptadecanoyl CoA → TG(i-20:0/15:0/17:0) + Coenzyme Adetails
DG(i-20:0/15:0/0:0) + Stearoyl-CoA → TG(i-20:0/15:0/18:0) + Coenzyme Adetails
DG(i-20:0/16:0/0:0) + Palmityl-CoA → TG(i-20:0/16:0/16:0) + Coenzyme Adetails
DG(i-20:0/16:0/0:0) + Heptadecanoyl CoA → TG(i-20:0/16:0/17:0) + Coenzyme Adetails
DG(i-20:0/16:0/0:0) + Stearoyl-CoA → TG(i-20:0/16:0/18:0) + Coenzyme Adetails
DG(i-20:0/17:0/0:0) + Heptadecanoyl CoA → TG(i-20:0/17:0/17:0) + Coenzyme Adetails
DG(i-20:0/17:0/0:0) + Stearoyl-CoA → TG(i-20:0/17:0/18:0) + Coenzyme Adetails
DG(i-20:0/18:0/0:0) + Stearoyl-CoA → TG(i-20:0/18:0/18:0) + Coenzyme Adetails
DG(i-20:0/i-20:0/0:0) + Lauroyl-CoA → TG(i-20:0/i-20:0/12:0) + Coenzyme Adetails
DG(i-20:0/i-20:0/0:0) + Tridecanoyl-CoA → TG(i-20:0/i-20:0/13:0) + Coenzyme Adetails
DG(i-20:0/i-20:0/0:0) + Palmityl-CoA → TG(i-20:0/i-20:0/16:0) + Coenzyme Adetails
DG(i-20:0/i-20:0/0:0) + Heptadecanoyl CoA → TG(i-20:0/i-20:0/17:0) + Coenzyme Adetails
DG(i-20:0/i-20:0/0:0) + Stearoyl-CoA → TG(i-20:0/i-20:0/18:0) + Coenzyme Adetails
DG(i-21:0/12:0/0:0) + Lauroyl-CoA → TG(i-21:0/12:0/12:0) + Coenzyme Adetails
DG(i-21:0/12:0/0:0) + Tridecanoyl-CoA → TG(i-21:0/12:0/13:0) + Coenzyme Adetails
DG(i-21:0/12:0/0:0) + Palmityl-CoA → TG(i-21:0/12:0/16:0) + Coenzyme Adetails
DG(i-21:0/12:0/0:0) + Heptadecanoyl CoA → TG(i-21:0/12:0/17:0) + Coenzyme Adetails
DG(i-21:0/12:0/0:0) + Stearoyl-CoA → TG(i-21:0/12:0/18:0) + Coenzyme Adetails
DG(i-21:0/13:0/0:0) + Tridecanoyl-CoA → TG(i-21:0/13:0/13:0) + Coenzyme Adetails
DG(i-21:0/13:0/0:0) + Palmityl-CoA → TG(i-21:0/13:0/16:0) + Coenzyme Adetails
DG(i-21:0/13:0/0:0) + Heptadecanoyl CoA → TG(i-21:0/13:0/17:0) + Coenzyme Adetails
DG(i-21:0/13:0/0:0) + Stearoyl-CoA → TG(i-21:0/13:0/18:0) + Coenzyme Adetails
DG(i-21:0/14:0/0:0) + Palmityl-CoA → TG(i-21:0/14:0/16:0) + Coenzyme Adetails
DG(i-21:0/14:0/0:0) + Heptadecanoyl CoA → TG(i-21:0/14:0/17:0) + Coenzyme Adetails
DG(i-21:0/14:0/0:0) + Stearoyl-CoA → TG(i-21:0/14:0/18:0) + Coenzyme Adetails
DG(i-21:0/15:0/0:0) + Palmityl-CoA → TG(i-21:0/15:0/16:0) + Coenzyme Adetails
DG(i-21:0/15:0/0:0) + Heptadecanoyl CoA → TG(i-21:0/15:0/17:0) + Coenzyme Adetails
DG(i-21:0/15:0/0:0) + Stearoyl-CoA → TG(i-21:0/15:0/18:0) + Coenzyme Adetails
DG(i-21:0/16:0/0:0) + Palmityl-CoA → TG(i-21:0/16:0/16:0) + Coenzyme Adetails
DG(i-21:0/16:0/0:0) + Heptadecanoyl CoA → TG(i-21:0/16:0/17:0) + Coenzyme Adetails
DG(i-21:0/16:0/0:0) + Stearoyl-CoA → TG(i-21:0/16:0/18:0) + Coenzyme Adetails
DG(i-21:0/17:0/0:0) + Heptadecanoyl CoA → TG(i-21:0/17:0/17:0) + Coenzyme Adetails
DG(i-21:0/17:0/0:0) + Stearoyl-CoA → TG(i-21:0/17:0/18:0) + Coenzyme Adetails
DG(i-21:0/18:0/0:0) + Stearoyl-CoA → TG(i-21:0/18:0/18:0) + Coenzyme Adetails
DG(i-21:0/i-21:0/0:0) + Lauroyl-CoA → TG(i-21:0/i-21:0/12:0) + Coenzyme Adetails
DG(i-21:0/i-21:0/0:0) + Tridecanoyl-CoA → TG(i-21:0/i-21:0/13:0) + Coenzyme Adetails
DG(i-21:0/i-21:0/0:0) + Palmityl-CoA → TG(i-21:0/i-21:0/16:0) + Coenzyme Adetails
DG(i-21:0/i-21:0/0:0) + Heptadecanoyl CoA → TG(i-21:0/i-21:0/17:0) + Coenzyme Adetails
DG(i-21:0/i-21:0/0:0) + Stearoyl-CoA → TG(i-21:0/i-21:0/18:0) + Coenzyme Adetails
DG(i-22:0/12:0/0:0) + Lauroyl-CoA → TG(i-22:0/12:0/12:0) + Coenzyme Adetails
DG(i-22:0/12:0/0:0) + Tridecanoyl-CoA → TG(i-22:0/12:0/13:0) + Coenzyme Adetails
DG(i-22:0/12:0/0:0) + Palmityl-CoA → TG(i-22:0/12:0/16:0) + Coenzyme Adetails
DG(i-22:0/12:0/0:0) + Heptadecanoyl CoA → TG(i-22:0/12:0/17:0) + Coenzyme Adetails
DG(i-22:0/12:0/0:0) + Stearoyl-CoA → TG(i-22:0/12:0/18:0) + Coenzyme Adetails
DG(i-22:0/13:0/0:0) + Tridecanoyl-CoA → TG(i-22:0/13:0/13:0) + Coenzyme Adetails
DG(i-22:0/13:0/0:0) + Palmityl-CoA → TG(i-22:0/13:0/16:0) + Coenzyme Adetails
DG(i-22:0/13:0/0:0) + Heptadecanoyl CoA → TG(i-22:0/13:0/17:0) + Coenzyme Adetails
DG(i-22:0/13:0/0:0) + Stearoyl-CoA → TG(i-22:0/13:0/18:0) + Coenzyme Adetails
DG(i-22:0/14:0/0:0) + Palmityl-CoA → TG(i-22:0/14:0/16:0) + Coenzyme Adetails
DG(i-22:0/14:0/0:0) + Heptadecanoyl CoA → TG(i-22:0/14:0/17:0) + Coenzyme Adetails
DG(i-22:0/14:0/0:0) + Stearoyl-CoA → TG(i-22:0/14:0/18:0) + Coenzyme Adetails
DG(i-22:0/15:0/0:0) + Palmityl-CoA → TG(i-22:0/15:0/16:0) + Coenzyme Adetails
DG(i-22:0/15:0/0:0) + Heptadecanoyl CoA → TG(i-22:0/15:0/17:0) + Coenzyme Adetails
DG(i-22:0/15:0/0:0) + Stearoyl-CoA → TG(i-22:0/15:0/18:0) + Coenzyme Adetails
DG(i-22:0/16:0/0:0) + Palmityl-CoA → TG(i-22:0/16:0/16:0) + Coenzyme Adetails
DG(i-22:0/16:0/0:0) + Heptadecanoyl CoA → TG(i-22:0/16:0/17:0) + Coenzyme Adetails
DG(i-22:0/16:0/0:0) + Stearoyl-CoA → TG(i-22:0/16:0/18:0) + Coenzyme Adetails
DG(i-22:0/17:0/0:0) + Heptadecanoyl CoA → TG(i-22:0/17:0/17:0) + Coenzyme Adetails
DG(i-22:0/17:0/0:0) + Stearoyl-CoA → TG(i-22:0/17:0/18:0) + Coenzyme Adetails
DG(i-22:0/18:0/0:0) + Stearoyl-CoA → TG(i-22:0/18:0/18:0) + Coenzyme Adetails
DG(i-22:0/i-22:0/0:0) + Lauroyl-CoA → TG(i-22:0/i-22:0/12:0) + Coenzyme Adetails
DG(i-22:0/i-22:0/0:0) + Tridecanoyl-CoA → TG(i-22:0/i-22:0/13:0) + Coenzyme Adetails
DG(i-22:0/i-22:0/0:0) + Palmityl-CoA → TG(i-22:0/i-22:0/16:0) + Coenzyme Adetails
DG(i-22:0/i-22:0/0:0) + Heptadecanoyl CoA → TG(i-22:0/i-22:0/17:0) + Coenzyme Adetails
DG(i-22:0/i-22:0/0:0) + Stearoyl-CoA → TG(i-22:0/i-22:0/18:0) + Coenzyme Adetails
DG(i-24:0/12:0/0:0) + Lauroyl-CoA → TG(i-24:0/12:0/12:0) + Coenzyme Adetails
DG(i-24:0/12:0/0:0) + Tridecanoyl-CoA → TG(i-24:0/12:0/13:0) + Coenzyme Adetails
DG(i-24:0/12:0/0:0) + Palmityl-CoA → TG(i-24:0/12:0/16:0) + Coenzyme Adetails
DG(i-24:0/12:0/0:0) + Heptadecanoyl CoA → TG(i-24:0/12:0/17:0) + Coenzyme Adetails
DG(i-24:0/12:0/0:0) + Stearoyl-CoA → TG(i-24:0/12:0/18:0) + Coenzyme Adetails
DG(i-24:0/13:0/0:0) + Tridecanoyl-CoA → TG(i-24:0/13:0/13:0) + Coenzyme Adetails
DG(i-24:0/13:0/0:0) + Palmityl-CoA → TG(i-24:0/13:0/16:0) + Coenzyme Adetails
DG(i-24:0/13:0/0:0) + Heptadecanoyl CoA → TG(i-24:0/13:0/17:0) + Coenzyme Adetails
DG(i-24:0/13:0/0:0) + Stearoyl-CoA → TG(i-24:0/13:0/18:0) + Coenzyme Adetails
DG(i-24:0/14:0/0:0) + Palmityl-CoA → TG(i-24:0/14:0/16:0) + Coenzyme Adetails
DG(i-24:0/14:0/0:0) + Heptadecanoyl CoA → TG(i-24:0/14:0/17:0) + Coenzyme Adetails
DG(i-24:0/14:0/0:0) + Stearoyl-CoA → TG(i-24:0/14:0/18:0) + Coenzyme Adetails
DG(i-24:0/15:0/0:0) + Palmityl-CoA → TG(i-24:0/15:0/16:0) + Coenzyme Adetails
DG(i-24:0/15:0/0:0) + Heptadecanoyl CoA → TG(i-24:0/15:0/17:0) + Coenzyme Adetails
DG(i-24:0/15:0/0:0) + Stearoyl-CoA → TG(i-24:0/15:0/18:0) + Coenzyme Adetails
DG(i-24:0/16:0/0:0) + Palmityl-CoA → TG(i-24:0/16:0/16:0) + Coenzyme Adetails
DG(i-24:0/16:0/0:0) + Heptadecanoyl CoA → TG(i-24:0/16:0/17:0) + Coenzyme Adetails
DG(i-24:0/16:0/0:0) + Stearoyl-CoA → TG(i-24:0/16:0/18:0) + Coenzyme Adetails
DG(i-24:0/17:0/0:0) + Heptadecanoyl CoA → TG(i-24:0/17:0/17:0) + Coenzyme Adetails
DG(i-24:0/17:0/0:0) + Stearoyl-CoA → TG(i-24:0/17:0/18:0) + Coenzyme Adetails
DG(i-24:0/18:0/0:0) + Stearoyl-CoA → TG(i-24:0/18:0/18:0) + Coenzyme Adetails
DG(i-24:0/i-24:0/0:0) + Lauroyl-CoA → TG(i-24:0/i-24:0/12:0) + Coenzyme Adetails
DG(i-24:0/i-24:0/0:0) + Tridecanoyl-CoA → TG(i-24:0/i-24:0/13:0) + Coenzyme Adetails
DG(i-24:0/i-24:0/0:0) + Palmityl-CoA → TG(i-24:0/i-24:0/16:0) + Coenzyme Adetails
DG(i-24:0/i-24:0/0:0) + Heptadecanoyl CoA → TG(i-24:0/i-24:0/17:0) + Coenzyme Adetails
DG(i-24:0/i-24:0/0:0) + Stearoyl-CoA → TG(i-24:0/i-24:0/18:0) + Coenzyme Adetails
General function:
Not Available
Specific function:
Converts 1-acyl-sn-glycerol-3-phosphate (lysophosphatidic acid or LPA) into 1,2-diacyl-sn-glycerol-3-phosphate (phosphatidic acid or PA) by incorporating an acyl moiety at the sn-2 position of the glycerol backbone.
Gene Name:
AGPAT1
Uniprot ID:
Q95JH2
Molecular weight:
32005.0
Reactions
1-Acyl-sn-glycerol 3-phosphate + Long-chain fatty acyl-CoA → Coenzyme A + 1,2-Diacyl-sn-glycerol 3-phosphatedetails
LPA(16:0/0:0) + Palmityl-CoA → Coenzyme A + PA(16:0/16:0)details
LPA(16:0/0:0) + Stearoyl-CoA → Coenzyme A + PA(16:0/18:0)details
LPA(16:0/0:0) + Oleoyl-CoA → Coenzyme A + PA(16:0/18:1(9Z))details
LPA(16:0/0:0) + Gamma-linolenoyl-CoA → Coenzyme A + PA(16:0/18:3(6Z,9Z,12Z))details
LPA(16:0/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(16:0/20:0)details
LPA(16:0/0:0) + Gondoyl-CoA → Coenzyme A + PA(16:0/20:1(11Z))details
LPA(16:0/0:0) + Docosanoyl-CoA → Coenzyme A + PA(16:0/22:0)details
LPA(16:0/0:0) + Erucoyl-CoA → Coenzyme A + PA(16:0/22:1(13Z))details
LPA(18:0/0:0) + Stearoyl-CoA → Coenzyme A + PA(18:0/18:0)details
LPA(18:0/0:0) + Oleoyl-CoA → Coenzyme A + PA(18:0/18:1(9Z))details
LPA(18:0/0:0) + Gamma-linolenoyl-CoA → Coenzyme A + PA(18:0/18:3(6Z,9Z,12Z))details
LPA(18:0/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(18:0/20:0)details
LPA(18:0/0:0) + Gondoyl-CoA → Coenzyme A + PA(18:0/20:1(11Z))details
LPA(18:0/0:0) + Docosanoyl-CoA → Coenzyme A + PA(18:0/22:0)details
LPA(18:0/0:0) + Erucoyl-CoA → Coenzyme A + PA(18:0/22:1(13Z))details
LysoPA(18:1(11Z)/0:0) + Oleoyl-CoA → Coenzyme A + PA(18:1(11Z)/18:1(9Z))details
LysoPA(18:1(11Z)/0:0) + Gamma-linolenoyl-CoA → Coenzyme A + PA(18:1(11Z)/18:3(6Z,9Z,12Z))details
LysoPA(18:1(11Z)/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(18:1(11Z)/20:0)details
LysoPA(18:1(11Z)/0:0) + Gondoyl-CoA → Coenzyme A + PA(18:1(11Z)/20:1(11Z))details
LysoPA(18:1(11Z)/0:0) + Docosanoyl-CoA → Coenzyme A + PA(18:1(11Z)/22:0)details
LysoPA(18:1(11Z)/0:0) + Erucoyl-CoA → Coenzyme A + PA(18:1(11Z)/22:1(13Z))details
LysoPA(18:1(9Z)/0:0) + Oleoyl-CoA → Coenzyme A + PA(18:1(9Z)/18:1(9Z))details
LysoPA(18:1(9Z)/0:0) + Gamma-linolenoyl-CoA → Coenzyme A + PA(18:1(9Z)/18:3(6Z,9Z,12Z))details
LysoPA(18:1(9Z)/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(18:1(9Z)/20:0)details
LysoPA(18:1(9Z)/0:0) + Gondoyl-CoA → Coenzyme A + PA(18:1(9Z)/20:1(11Z))details
LysoPA(18:1(9Z)/0:0) + Docosanoyl-CoA → Coenzyme A + PA(18:1(9Z)/22:0)details
LysoPA(18:1(9Z)/0:0) + Erucoyl-CoA → Coenzyme A + PA(18:1(9Z)/22:1(13Z))details
LysoPA(18:2(9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → Coenzyme A + PA(18:2(9Z,12Z)/18:3(6Z,9Z,12Z))details
LysoPA(18:2(9Z,12Z)/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(18:2(9Z,12Z)/20:0)details
LysoPA(18:2(9Z,12Z)/0:0) + Gondoyl-CoA → Coenzyme A + PA(18:2(9Z,12Z)/20:1(11Z))details
LysoPA(18:2(9Z,12Z)/0:0) + Docosanoyl-CoA → Coenzyme A + PA(18:2(9Z,12Z)/22:0)details
LysoPA(18:2(9Z,12Z)/0:0) + Erucoyl-CoA → Coenzyme A + PA(18:2(9Z,12Z)/22:1(13Z))details
LysoPA(18:3(6Z,9Z,12Z)/0:0) + Gamma-linolenoyl-CoA → Coenzyme A + PA(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z))details
LysoPA(18:3(6Z,9Z,12Z)/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(18:3(6Z,9Z,12Z)/20:0)details
LysoPA(18:3(6Z,9Z,12Z)/0:0) + Gondoyl-CoA → Coenzyme A + PA(18:3(6Z,9Z,12Z)/20:1(11Z))details
LysoPA(18:3(6Z,9Z,12Z)/0:0) + Docosanoyl-CoA → Coenzyme A + PA(18:3(6Z,9Z,12Z)/22:0)details
LysoPA(18:3(6Z,9Z,12Z)/0:0) + Erucoyl-CoA → Coenzyme A + PA(18:3(6Z,9Z,12Z)/22:1(13Z))details
LysoPA(18:3(9Z,12Z,15Z)/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(18:3(9Z,12Z,15Z)/20:0)details
LysoPA(18:3(9Z,12Z,15Z)/0:0) + Gondoyl-CoA → Coenzyme A + PA(18:3(9Z,12Z,15Z)/20:1(11Z))details
LysoPA(18:3(9Z,12Z,15Z)/0:0) + Docosanoyl-CoA → Coenzyme A + PA(18:3(9Z,12Z,15Z)/22:0)details
LysoPA(18:3(9Z,12Z,15Z)/0:0) + Erucoyl-CoA → Coenzyme A + PA(18:3(9Z,12Z,15Z)/22:1(13Z))details
LysoPA(20:0/0:0) + Eicosanoyl-CoA → Coenzyme A + PA(20:0/20:0)details
LysoPA(20:0/0:0) + Gondoyl-CoA → Coenzyme A + PA(20:0/20:1(11Z))details
LysoPA(20:0/0:0) + Docosanoyl-CoA → Coenzyme A + PA(20:0/22:0)details
LysoPA(20:0/0:0) + Erucoyl-CoA → Coenzyme A + PA(20:0/22:1(13Z))details
LysoPA(20:1(11Z)/0:0) + Gondoyl-CoA → Coenzyme A + PA(20:1(11Z)/20:1(11Z))details
LysoPA(20:1(11Z)/0:0) + Docosanoyl-CoA → Coenzyme A + PA(20:1(11Z)/22:0)details
LysoPA(20:1(11Z)/0:0) + Erucoyl-CoA → Coenzyme A + PA(20:1(11Z)/22:1(13Z))details
LysoPA(22:0/0:0) + Docosanoyl-CoA → Coenzyme A + PA(22:0/22:0)details
LysoPA(22:0/0:0) + Erucoyl-CoA → Coenzyme A + PA(22:0/22:1(13Z))details
LysoPA(22:1(13Z)/0:0) + Erucoyl-CoA → Coenzyme A + PA(22:1(13Z)/22:1(13Z))details
Palmityl-CoA + LPA(16:0/0:0) → PA(16:0/16:0) + Coenzyme Adetails
General function:
Not Available
Specific function:
Converts 1-acyl-sn-glycerol-3-phosphate (lysophosphatidic acid or LPA) into 1,2-diacyl-sn-glycerol-3-phosphate (phosphatidic acid or PA) by incorporating an acyl moiety at the sn-2 position of the glycerol backbone (By similarity). Exhibits high acyl-CoA specificity for polyunsaturated fatty acyl-CoA, especially docosahexaenoyl-CoA (22:6-CoA, DHA-CoA) (By similarity).
Gene Name:
AGPAT4
Uniprot ID:
Q5E9R2
Molecular weight:
43907.0
Reactions
LPA(16:0/0:0) + Palmityl-CoA → PA(16:0/16:0) + Coenzyme Adetails
LPA(16:0/0:0) + Stearoyl-CoA → PA(16:0/18:0) + Coenzyme Adetails
LPA(16:0/0:0) + Oleoyl-CoA → PA(16:0/18:1(9Z)) + Coenzyme Adetails
LPA(18:0/0:0) + Stearoyl-CoA → PA(18:0/18:0) + Coenzyme Adetails
LPA(18:0/0:0) + Oleoyl-CoA → PA(18:0/18:1(9Z)) + Coenzyme Adetails
LysoPA(18:1(11Z)/0:0) + Oleoyl-CoA → PA(18:1(11Z)/18:1(9Z)) + Coenzyme Adetails
LysoPA(18:1(9Z)/0:0) + Oleoyl-CoA → PA(18:1(9Z)/18:1(9Z)) + Coenzyme Adetails
General function:
Not Available
Specific function:
Not Available
Gene Name:
DLD
Uniprot ID:
F1N206
Molecular weight:
54187.0
Reactions
Pyruvic acid + Coenzyme A + NAD → Acetyl-CoA + Carbon dioxide + NADHdetails
Oxoadipic acid + Coenzyme A → Glutaryl-CoA + Carbon dioxidedetails
2-Ketobutyric acid + Coenzyme A + NAD → Propionyl-CoA + NADHdetails
General function:
Not Available
Specific function:
Not Available
Gene Name:
ACSS2
Uniprot ID:
A7YWF1
Molecular weight:
78734.0
Reactions
Adenosine triphosphate + Acetic acid + Coenzyme A → Adenosine monophosphate + Pyrophosphate + Acetyl-CoAdetails
General function:
Not Available
Specific function:
Not Available
Gene Name:
DCAKD
Uniprot ID:
Q3ZBS0
Molecular weight:
26384.0
Reactions
Adenosine triphosphate + Dephospho-CoA → ADP + Coenzyme Adetails
General function:
Not Available
Specific function:
Not Available
Gene Name:
ACOT12
Uniprot ID:
E1BNW7
Molecular weight:
62106.0
Reactions
Coenzyme A + Acetic acid → Water + Acetyl-CoAdetails
General function:
Not Available
Specific function:
Not Available
Gene Name:
AceCS2
Uniprot ID:
Q9BEA3
Molecular weight:
74310.0
Reactions
Adenosine triphosphate + Acetic acid + Coenzyme A → Adenosine monophosphate + Pyrophosphate + Acetyl-CoAdetails
General function:
Not Available
Specific function:
Mediates the ATP-dependent import of long-chain fatty acids (LCFA) into the cell by mediating their translocation at the plasma membrane. Has also an acyl-CoA ligase activity for long-chain and very-long-chain fatty acids. May act directly as a bona fide transporter, or alternatively, in a cytoplasmic or membrane-associated multimeric protein complex to trap and draw fatty acids towards accumulation. Plays a pivotal role in regulating available LCFA substrates from exogenous sources in tissues undergoing high levels of beta-oxidation or triglyceride synthesis. May be involved in regulation of cholesterol metabolism.
Gene Name:
SLC27A1
Uniprot ID:
Q3ZKN0
Molecular weight:
71123.0
Reactions
Phytanic acid + Adenosine triphosphate + Coenzyme A → Phytanoyl-CoA + ADP + Pyrophosphatedetails
3a,7a-Dihydroxycoprostanic acid + Adenosine triphosphate + Coenzyme A → 3a,7a-Dihydroxy-5b-cholestanoyl-CoA + Pyrophosphate + 3'-AMPdetails
General function:
Not Available
Specific function:
Not Available
Gene Name:
GNPNAT1
Uniprot ID:
Q08DV2
Molecular weight:
20776.0
Reactions
Acetyl-CoA + Glucosamine 6-phosphate → N-Acetyl-D-Glucosamine 6-Phosphate + Coenzyme Adetails