You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Bovine Metabolome Database.
Record Information
Version1.0
Creation Date2016-09-30 22:47:43 UTC
Update Date2020-05-19 22:00:49 UTC
BMDB IDBMDB0001564
Secondary Accession Numbers
  • BMDB01564
Metabolite Identification
Common NameCDP-Ethanolamine
DescriptionCDP-ethanolamine belongs to the class of organic compounds known as cdp-ethanolamines. These are phosphoethanolamines that consist of an ethanolamine having a cytidine 5'-diphosphate moiety attached to the oxygen. CDP-ethanolamine is a very strong basic compound (based on its pKa). CDP-ethanolamine exists in all living species, ranging from bacteria to humans.
Structure
Thumb
Synonyms
ValueSource
CDP EthanolamineChEBI
Cytidine 5'-(trihydrogen diphosphate), p'-(2-aminoethyl) esterChEBI
Cytidine diphosphate ethanolamineChEBI
Cytidine 5'-(trihydrogen diphosphoric acid), p'-(2-aminoethyl) esterGenerator
Cytidine diphosphoric acid ethanolamineGenerator
CDPethanolamineHMDB
CDP Ethanolamine, p'-(32)p-labeledHMDB
Cytidine 5'-diphosphate ethanolamineHMDB
Cytidine 5'-diphosphoethanolamineHMDB
Cytidine 5’-diphosphate ethanolamineHMDB
Cytidine 5’-diphosphoethanolamineHMDB
Cytidine diphosphoethanolamineHMDB
CDP-ethanolamineHMDB
Chemical FormulaC11H20N4O11P2
Average Molecular Weight446.2442
Monoisotopic Molecular Weight446.060380526
IUPAC Name{[(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}({[(2-aminoethoxy)(hydroxy)phosphoryl]oxy})phosphinic acid
Traditional Namecdp ethanolamine
CAS Registry Number3036-18-8
SMILES
NCCOP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(N)=NC1=O
InChI Identifier
InChI=1S/C11H20N4O11P2/c12-2-4-23-27(19,20)26-28(21,22)24-5-6-8(16)9(17)10(25-6)15-3-1-7(13)14-11(15)18/h1,3,6,8-10,16-17H,2,4-5,12H2,(H,19,20)(H,21,22)(H2,13,14,18)/t6-,8-,9-,10-/m1/s1
InChI KeyWVIMUEUQJFPNDK-PEBGCTIMSA-N
Chemical Taxonomy
Description belongs to the class of organic compounds known as cdp-ethanolamines. These are phosphoethanolamines that consist of an ethanolamine having a cytidine 5'-diphosphate moiety attached to the oxygen.
KingdomOrganic compounds
Super ClassNucleosides, nucleotides, and analogues
ClassPyrimidine nucleotides
Sub ClassPyrimidine ribonucleotides
Direct ParentCDP-ethanolamines
Alternative Parents
Substituents
  • Cdp-ethanolamine
  • Pentose phosphate
  • Pentose-5-phosphate
  • Glycosyl compound
  • N-glycosyl compound
  • Monosaccharide phosphate
  • Organic pyrophosphate
  • Phosphoethanolamine
  • Hydroxypyrimidine
  • Monoalkyl phosphate
  • Hydropyrimidine
  • Monosaccharide
  • Organic phosphoric acid derivative
  • Phosphoric acid ester
  • Pyrimidine
  • Alkyl phosphate
  • Tetrahydrofuran
  • Heteroaromatic compound
  • 1,2-diol
  • Secondary alcohol
  • Organoheterocyclic compound
  • Azacycle
  • Oxacycle
  • Primary amine
  • Organic oxide
  • Amine
  • Alcohol
  • Organopnictogen compound
  • Primary aliphatic amine
  • Organonitrogen compound
  • Organic nitrogen compound
  • Organooxygen compound
  • Hydrocarbon derivative
  • Organic oxygen compound
  • Aromatic heteromonocyclic compound
Molecular FrameworkAromatic heteromonocyclic compounds
External Descriptors
Ontology
StatusExpected but not Quantified
Origin
  • Endogenous
BiofunctionNot Available
ApplicationNot Available
Cellular locations
  • Cytoplasm
Physical Properties
StateSolid
Experimental Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Predicted Properties
PropertyValueSource
logP-1.7ALOGPS
logP-5ChemAxon
logS-1.5ALOGPS
pKa (Strongest Acidic)1.85ChemAxon
pKa (Strongest Basic)10ChemAxon
Physiological Charge-1ChemAxon
Hydrogen Acceptor Count11ChemAxon
Hydrogen Donor Count6ChemAxon
Polar Surface Area236.69 ŲChemAxon
Rotatable Bond Count9ChemAxon
Refractivity88.72 m³·mol⁻¹ChemAxon
Polarizability36.43 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Spectra
Spectra
Spectrum TypeDescriptionSplash Key
Predicted GC-MSPredicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positivesplash10-004i-6793400000-ac76da0c6087752db3c9View in MoNA
Predicted GC-MSPredicted GC-MS Spectrum - GC-MS (2 TMS) - 70eV, Positivesplash10-00pj-8972160000-fd358ed61430e64ed4e0View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Positivesplash10-03di-5910100000-2a4aae3a59f3f928bc14View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Positivesplash10-03dl-7900000000-70f4dc43398ae42bd718View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Positivesplash10-03dl-9700000000-2d6893ab115d449880c3View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Negativesplash10-0gvk-1512900000-bd91f3bd3454ae8dc4daView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Negativesplash10-0n4i-6942200000-8c75516485feb49d2fa1View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Negativesplash10-06tf-5900000000-624299483014ca3a86f4View in MoNA
Biological Properties
Cellular Locations
  • Cytoplasm
Biospecimen Locations
  • Intestine
  • Placenta
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
IntestineExpected but not QuantifiedNot ApplicableNot SpecifiedNot SpecifiedNormal
  • Not Applicable
details
PlacentaExpected but not QuantifiedNot ApplicableNot SpecifiedNot SpecifiedNormal
  • Not Applicable
details
Abnormal Concentrations
Not Available
HMDB IDHMDB0001564
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB022691
KNApSAcK IDNot Available
Chemspider ID110296
KEGG Compound IDC00570
BioCyc IDNot Available
BiGG ID35382
Wikipedia LinkNot Available
METLIN ID3538
PubChem Compound123727
PDB IDNot Available
ChEBI ID16732
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General ReferencesNot Available

Enzymes

General function:
Involved in ethanolaminephosphotransferase activity
Specific function:
Catalyzes phosphatidylethanolamine biosynthesis from CDP-ethanolamine. It thereby plays a central role in the formation and maintenance of vesicular membranes. Involved in the foramtion of phosphatidylethanolamine via 'Kennedy' pathway (By similarity).
Gene Name:
SELENOI
Uniprot ID:
Q17QM4
Molecular weight:
45214.0
Reactions
CDP-Ethanolamine + 1,2-Diacyl-sn-glycerol → an L-1-Phosphatidylethanolamine + Cytidine monophosphatedetails
CDP-Ethanolamine + DG(16:0/16:0/0:0) → Cytidine monophosphate + PE(16:0/16:0)details
CDP-Ethanolamine + DG(14:0/14:0/0:0) → Cytidine monophosphate + PE(14:0/14:0)details
CDP-Ethanolamine + DG(14:0/14:1(9Z)/0:0) → Cytidine monophosphate + PE(14:0/14:1(9Z))details
CDP-Ethanolamine + DG(14:0/15:0/0:0) → Cytidine monophosphate + PE(14:0/15:0)details
CDP-Ethanolamine + DG(14:0/16:0/0:0) → Cytidine monophosphate + PE(14:0/16:0)details
CDP-Ethanolamine + DG(14:0/16:1(9Z)/0:0) → Cytidine monophosphate + PE(14:0/16:1(9Z))details
CDP-Ethanolamine + DG(14:0/18:0/0:0) → Cytidine monophosphate + PE(14:0/18:0)details
CDP-Ethanolamine + DG(14:0/18:1(11Z)/0:0) → Cytidine monophosphate + PE(14:0/18:1(11Z))details
CDP-Ethanolamine + DG(14:0/18:1(9Z)/0:0) → Cytidine monophosphate + PE(14:0/18:1(9Z))details
CDP-Ethanolamine + DG(14:0/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(14:0/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(14:0/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(14:0/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(14:0/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(14:0/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(14:0/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(14:0/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(14:0/20:0/0:0) → Cytidine monophosphate + PE(14:0/20:0)details
CDP-Ethanolamine + DG(14:0/20:1(11Z)/0:0) → Cytidine monophosphate + PE(14:0/20:1(11Z))details
CDP-Ethanolamine + DG(14:0/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(14:0/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(14:0/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(14:0/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(14:0/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(14:0/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(14:0/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(14:0/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(14:0/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(14:0/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(14:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(14:0/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(14:0/22:0/0:0) → Cytidine monophosphate + PE(14:0/22:0)details
CDP-Ethanolamine + DG(14:0/22:1(13Z)/0:0) → Cytidine monophosphate + PE(14:0/22:1(13Z))details
CDP-Ethanolamine + DG(14:0/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(14:0/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(14:0/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(14:0/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(14:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(14:0/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(14:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(14:0/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(14:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(14:0/24:0/0:0) → Cytidine monophosphate + PE(14:0/24:0)details
CDP-Ethanolamine + DG(14:0/24:1(15Z)/0:0) → Cytidine monophosphate + PE(14:0/24:1(15Z))details
CDP-Ethanolamine + DG(14:1(9Z)/14:1(9Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/14:1(9Z))details
CDP-Ethanolamine + DG(14:1(9Z)/15:0/0:0) → Cytidine monophosphate + PE(14:1(9Z)/15:0)details
CDP-Ethanolamine + DG(14:1(9Z)/16:0/0:0) → Cytidine monophosphate + PE(14:1(9Z)/16:0)details
CDP-Ethanolamine + DG(14:1(9Z)/16:1(9Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/16:1(9Z))details
CDP-Ethanolamine + DG(14:1(9Z)/18:0/0:0) → Cytidine monophosphate + PE(14:1(9Z)/18:0)details
CDP-Ethanolamine + DG(14:1(9Z)/18:1(11Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/18:1(11Z))details
CDP-Ethanolamine + DG(14:1(9Z)/18:1(9Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/18:1(9Z))details
CDP-Ethanolamine + DG(14:1(9Z)/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(14:1(9Z)/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(14:1(9Z)/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(14:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(14:1(9Z)/20:0/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:0)details
CDP-Ethanolamine + DG(14:1(9Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:1(11Z))details
CDP-Ethanolamine + DG(14:1(9Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(14:1(9Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(14:1(9Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(14:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(14:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(14:1(9Z)/22:0/0:0) → Cytidine monophosphate + PE(14:1(9Z)/22:0)details
CDP-Ethanolamine + DG(14:1(9Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/22:1(13Z))details
CDP-Ethanolamine + DG(14:1(9Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(14:1(9Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(14:1(9Z)/24:0/0:0) → Cytidine monophosphate + PE(14:1(9Z)/24:0)details
CDP-Ethanolamine + DG(14:1(9Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(14:1(9Z)/24:1(15Z))details
CDP-Ethanolamine + DG(15:0/15:0/0:0) → Cytidine monophosphate + PE(15:0/15:0)details
CDP-Ethanolamine + DG(15:0/16:0/0:0) → Cytidine monophosphate + PE(15:0/16:0)details
CDP-Ethanolamine + DG(15:0/16:1(9Z)/0:0) → Cytidine monophosphate + PE(15:0/16:1(9Z))details
CDP-Ethanolamine + DG(15:0/18:0/0:0) → Cytidine monophosphate + PE(15:0/18:0)details
CDP-Ethanolamine + DG(15:0/18:1(11Z)/0:0) → Cytidine monophosphate + PE(15:0/18:1(11Z))details
CDP-Ethanolamine + DG(15:0/18:1(9Z)/0:0) → Cytidine monophosphate + PE(15:0/18:1(9Z))details
CDP-Ethanolamine + DG(15:0/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(15:0/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(15:0/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(15:0/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(15:0/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(15:0/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(15:0/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(15:0/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(15:0/20:0/0:0) → Cytidine monophosphate + PE(15:0/20:0)details
CDP-Ethanolamine + DG(15:0/20:1(11Z)/0:0) → Cytidine monophosphate + PE(15:0/20:1(11Z))details
CDP-Ethanolamine + DG(15:0/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(15:0/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(15:0/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(15:0/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(15:0/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(15:0/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(15:0/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(15:0/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(15:0/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(15:0/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(15:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(15:0/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(15:0/22:0/0:0) → Cytidine monophosphate + PE(15:0/22:0)details
CDP-Ethanolamine + DG(15:0/22:1(13Z)/0:0) → Cytidine monophosphate + PE(15:0/22:1(13Z))details
CDP-Ethanolamine + DG(15:0/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(15:0/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(15:0/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(15:0/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(15:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(15:0/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(15:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(15:0/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(15:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(15:0/24:0/0:0) → Cytidine monophosphate + PE(15:0/24:0)details
CDP-Ethanolamine + DG(15:0/24:1(15Z)/0:0) → Cytidine monophosphate + PE(15:0/24:1(15Z))details
CDP-Ethanolamine + DG(16:0/16:1(9Z)/0:0) → Cytidine monophosphate + PE(16:0/16:1(9Z))details
CDP-Ethanolamine + DG(16:0/18:0/0:0) → Cytidine monophosphate + PE(16:0/18:0)details
CDP-Ethanolamine + DG(16:0/18:1(11Z)/0:0) → Cytidine monophosphate + PE(16:0/18:1(11Z))details
CDP-Ethanolamine + DG(16:0/18:1(9Z)/0:0) → Cytidine monophosphate + PE(16:0/18:1(9Z))details
CDP-Ethanolamine + DG(16:0/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(16:0/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(16:0/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(16:0/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(16:0/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(16:0/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(16:0/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(16:0/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(16:0/20:0/0:0) → Cytidine monophosphate + PE(16:0/20:0)details
CDP-Ethanolamine + DG(16:0/20:1(11Z)/0:0) → Cytidine monophosphate + PE(16:0/20:1(11Z))details
CDP-Ethanolamine + DG(16:0/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(16:0/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(16:0/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(16:0/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(16:0/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(16:0/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(16:0/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(16:0/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(16:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(16:0/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(16:0/22:0/0:0) → Cytidine monophosphate + PE(16:0/22:0)details
CDP-Ethanolamine + DG(16:0/22:1(13Z)/0:0) → Cytidine monophosphate + PE(16:0/22:1(13Z))details
CDP-Ethanolamine + DG(16:0/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(16:0/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(16:0/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(16:0/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(16:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(16:0/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(16:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(16:0/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(16:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(16:0/24:0/0:0) → Cytidine monophosphate + PE(16:0/24:0)details
CDP-Ethanolamine + DG(16:0/24:1(15Z)/0:0) → Cytidine monophosphate + PE(16:0/24:1(15Z))details
CDP-Ethanolamine + DG(16:1(9Z)/16:1(9Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/16:1(9Z))details
CDP-Ethanolamine + DG(16:1(9Z)/18:0/0:0) → Cytidine monophosphate + PE(16:1(9Z)/18:0)details
CDP-Ethanolamine + DG(16:1(9Z)/18:1(11Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/18:1(11Z))details
CDP-Ethanolamine + DG(16:1(9Z)/18:1(9Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/18:1(9Z))details
CDP-Ethanolamine + DG(16:1(9Z)/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(16:1(9Z)/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(16:1(9Z)/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(16:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(16:1(9Z)/20:0/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:0)details
CDP-Ethanolamine + DG(16:1(9Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:1(11Z))details
CDP-Ethanolamine + DG(16:1(9Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(16:1(9Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(16:1(9Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(16:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(16:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(16:1(9Z)/22:0/0:0) → Cytidine monophosphate + PE(16:1(9Z)/22:0)details
CDP-Ethanolamine + DG(16:1(9Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/22:1(13Z))details
CDP-Ethanolamine + DG(16:1(9Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(16:1(9Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(16:1(9Z)/24:0/0:0) → Cytidine monophosphate + PE(16:1(9Z)/24:0)details
CDP-Ethanolamine + DG(16:1(9Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(16:1(9Z)/24:1(15Z))details
CDP-Ethanolamine + DG(18:0/18:0/0:0) → Cytidine monophosphate + PE(18:0/18:0)details
CDP-Ethanolamine + DG(18:0/18:1(11Z)/0:0) → Cytidine monophosphate + PE(18:0/18:1(11Z))details
CDP-Ethanolamine + DG(18:0/18:1(9Z)/0:0) → Cytidine monophosphate + PE(18:0/18:1(9Z))details
CDP-Ethanolamine + DG(18:0/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:0/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(18:0/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:0/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(18:0/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:0/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:0/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:0/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:0/20:0/0:0) → Cytidine monophosphate + PE(18:0/20:0)details
CDP-Ethanolamine + DG(18:0/20:1(11Z)/0:0) → Cytidine monophosphate + PE(18:0/20:1(11Z))details
CDP-Ethanolamine + DG(18:0/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:0/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(18:0/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(18:0/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(18:0/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:0/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:0/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:0/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:0/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:0/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:0/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:0/22:0/0:0) → Cytidine monophosphate + PE(18:0/22:0)details
CDP-Ethanolamine + DG(18:0/22:1(13Z)/0:0) → Cytidine monophosphate + PE(18:0/22:1(13Z))details
CDP-Ethanolamine + DG(18:0/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:0/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(18:0/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:0/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:0/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:0/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:0/24:0/0:0) → Cytidine monophosphate + PE(18:0/24:0)details
CDP-Ethanolamine + DG(18:0/24:1(15Z)/0:0) → Cytidine monophosphate + PE(18:0/24:1(15Z))details
CDP-Ethanolamine + DG(18:1(11Z)/18:1(11Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/18:1(11Z))details
CDP-Ethanolamine + DG(18:1(11Z)/18:1(9Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/18:1(9Z))details
CDP-Ethanolamine + DG(18:1(11Z)/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(18:1(11Z)/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(18:1(11Z)/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:1(11Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:1(11Z)/20:0/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:0)details
CDP-Ethanolamine + DG(18:1(11Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:1(11Z))details
CDP-Ethanolamine + DG(18:1(11Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(18:1(11Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(18:1(11Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:1(11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:1(11Z)/22:0/0:0) → Cytidine monophosphate + PE(18:1(11Z)/22:0)details
CDP-Ethanolamine + DG(18:1(11Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/22:1(13Z))details
CDP-Ethanolamine + DG(18:1(11Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(18:1(11Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:1(11Z)/24:0/0:0) → Cytidine monophosphate + PE(18:1(11Z)/24:0)details
CDP-Ethanolamine + DG(18:1(11Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(18:1(11Z)/24:1(15Z))details
CDP-Ethanolamine + DG(18:1(9Z)/18:1(9Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/18:1(9Z))details
CDP-Ethanolamine + DG(18:1(9Z)/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(18:1(9Z)/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(18:1(9Z)/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:1(9Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:1(9Z)/20:0/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:0)details
CDP-Ethanolamine + DG(18:1(9Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:1(11Z))details
CDP-Ethanolamine + DG(18:1(9Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(18:1(9Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(18:1(9Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:1(9Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:1(9Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:1(9Z)/22:0/0:0) → Cytidine monophosphate + PE(18:1(9Z)/22:0)details
CDP-Ethanolamine + DG(18:1(9Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/22:1(13Z))details
CDP-Ethanolamine + DG(18:1(9Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(18:1(9Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:1(9Z)/24:0/0:0) → Cytidine monophosphate + PE(18:1(9Z)/24:0)details
CDP-Ethanolamine + DG(18:1(9Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(18:1(9Z)/24:1(15Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/18:2(9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/18:2(9Z,12Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:0/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:0)details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:1(11Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/22:0/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/22:0)details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/22:1(13Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/24:0/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/24:0)details
CDP-Ethanolamine + DG(18:2(9Z,12Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(18:2(9Z,12Z)/24:1(15Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/18:3(6Z,9Z,12Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:0/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:0)details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:1(11Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/22:0/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/22:0)details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/22:1(13Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/24:0/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/24:0)details
CDP-Ethanolamine + DG(18:3(6Z,9Z,12Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(18:3(6Z,9Z,12Z)/24:1(15Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:0/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:0)details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:1(11Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/22:0/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/22:0)details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/22:1(13Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/24:0/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/24:0)details
CDP-Ethanolamine + DG(18:3(9Z,12Z,15Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(18:3(9Z,12Z,15Z)/24:1(15Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/18:4(6Z,9Z,12Z,15Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:0/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:0)details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:1(11Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/22:0/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/22:0)details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/22:1(13Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/24:0/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/24:0)details
CDP-Ethanolamine + DG(18:4(6Z,9Z,12Z,15Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(18:4(6Z,9Z,12Z,15Z)/24:1(15Z))details
CDP-Ethanolamine + DG(20:0/20:0/0:0) → Cytidine monophosphate + PE(20:0/20:0)details
CDP-Ethanolamine + DG(20:0/20:1(11Z)/0:0) → Cytidine monophosphate + PE(20:0/20:1(11Z))details
CDP-Ethanolamine + DG(20:0/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:0/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(20:0/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(20:0/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(20:0/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:0/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:0/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:0/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:0/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:0/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:0/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:0/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:0/22:0/0:0) → Cytidine monophosphate + PE(20:0/22:0)details
CDP-Ethanolamine + DG(20:0/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:0/22:1(13Z))details
CDP-Ethanolamine + DG(20:0/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:0/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:0/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:0/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:0/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:0/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:0/24:0/0:0) → Cytidine monophosphate + PE(20:0/24:0)details
CDP-Ethanolamine + DG(20:0/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:0/24:1(15Z))details
CDP-Ethanolamine + DG(20:1(11Z)/20:1(11Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/20:1(11Z))details
CDP-Ethanolamine + DG(20:1(11Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(20:1(11Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(20:1(11Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:1(11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:1(11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:1(11Z)/22:0/0:0) → Cytidine monophosphate + PE(20:1(11Z)/22:0)details
CDP-Ethanolamine + DG(20:1(11Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/22:1(13Z))details
CDP-Ethanolamine + DG(20:1(11Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:1(11Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:1(11Z)/24:0/0:0) → Cytidine monophosphate + PE(20:1(11Z)/24:0)details
CDP-Ethanolamine + DG(20:1(11Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:1(11Z)/24:1(15Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/20:2(11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/20:2(11Z,14Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/22:0/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/22:0)details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/22:1(13Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/24:0/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/24:0)details
CDP-Ethanolamine + DG(20:2(11Z,14Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:2(11Z,14Z)/24:1(15Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/20:3(5Z,8Z,11Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/22:0/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/22:0)details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/22:1(13Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/24:0/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/24:0)details
CDP-Ethanolamine + DG(20:3(5Z,8Z,11Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:3(5Z,8Z,11Z)/24:1(15Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/20:3(8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/22:0/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/22:0)details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/22:1(13Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/24:0/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/24:0)details
CDP-Ethanolamine + DG(20:3(8Z,11Z,14Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:3(8Z,11Z,14Z)/24:1(15Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/20:4(5Z,8Z,11Z,14Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/22:0/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/22:0)details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/22:1(13Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/24:0/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/24:0)details
CDP-Ethanolamine + DG(20:4(5Z,8Z,11Z,14Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:4(5Z,8Z,11Z,14Z)/24:1(15Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/20:4(8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/22:0/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/22:0)details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/22:1(13Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/24:0/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/24:0)details
CDP-Ethanolamine + DG(20:4(8Z,11Z,14Z,17Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:4(8Z,11Z,14Z,17Z)/24:1(15Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/20:5(5Z,8Z,11Z,14Z,17Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:0/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:0)details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:1(13Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/24:0/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:0)details
CDP-Ethanolamine + DG(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(20:5(5Z,8Z,11Z,14Z,17Z)/24:1(15Z))details
CDP-Ethanolamine + DG(22:0/22:0/0:0) → Cytidine monophosphate + PE(22:0/22:0)details
CDP-Ethanolamine + DG(22:0/22:1(13Z)/0:0) → Cytidine monophosphate + PE(22:0/22:1(13Z))details
CDP-Ethanolamine + DG(22:0/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:0/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(22:0/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:0/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:0/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:0/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:0/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:0/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:0/24:0/0:0) → Cytidine monophosphate + PE(22:0/24:0)details
CDP-Ethanolamine + DG(22:0/24:1(15Z)/0:0) → Cytidine monophosphate + PE(22:0/24:1(15Z))details
CDP-Ethanolamine + DG(22:1(13Z)/22:1(13Z)/0:0) → Cytidine monophosphate + PE(22:1(13Z)/22:1(13Z))details
CDP-Ethanolamine + DG(22:1(13Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:1(13Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(22:1(13Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:1(13Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:1(13Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:1(13Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:1(13Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:1(13Z)/24:0/0:0) → Cytidine monophosphate + PE(22:1(13Z)/24:0)details
CDP-Ethanolamine + DG(22:1(13Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(22:1(13Z)/24:1(15Z))details
CDP-Ethanolamine + DG(22:2(13Z,16Z)/22:2(13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:2(13Z,16Z)/22:2(13Z,16Z))details
CDP-Ethanolamine + DG(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:2(13Z,16Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:2(13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:2(13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:2(13Z,16Z)/24:0/0:0) → Cytidine monophosphate + PE(22:2(13Z,16Z)/24:0)details
CDP-Ethanolamine + DG(22:2(13Z,16Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(22:2(13Z,16Z)/24:1(15Z))details
CDP-Ethanolamine + DG(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:4(7Z,10Z,13Z,16Z)/22:4(7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:4(7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:4(7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:4(7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:4(7Z,10Z,13Z,16Z)/24:0/0:0) → Cytidine monophosphate + PE(22:4(7Z,10Z,13Z,16Z)/24:0)details
CDP-Ethanolamine + DG(22:4(7Z,10Z,13Z,16Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(22:4(7Z,10Z,13Z,16Z)/24:1(15Z))details
CDP-Ethanolamine + DG(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z)/0:0) → Cytidine monophosphate + PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(4Z,7Z,10Z,13Z,16Z))details
CDP-Ethanolamine + DG(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:5(4Z,7Z,10Z,13Z,16Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:5(4Z,7Z,10Z,13Z,16Z)/24:0/0:0) → Cytidine monophosphate + PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:0)details
CDP-Ethanolamine + DG(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(22:5(4Z,7Z,10Z,13Z,16Z)/24:1(15Z))details
CDP-Ethanolamine + DG(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:5(7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:5(7Z,10Z,13Z,16Z,19Z)/24:0/0:0) → Cytidine monophosphate + PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:0)details
CDP-Ethanolamine + DG(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(22:5(7Z,10Z,13Z,16Z,19Z)/24:1(15Z))details
CDP-Ethanolamine + DG(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) → Cytidine monophosphate + PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))details
CDP-Ethanolamine + DG(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0/0:0) → Cytidine monophosphate + PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:0)details
CDP-Ethanolamine + DG(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/24:1(15Z))details
CDP-Ethanolamine + DG(24:0/24:0/0:0) → Cytidine monophosphate + PE(24:0/24:0)details
CDP-Ethanolamine + DG(24:0/24:1(15Z)/0:0) → Cytidine monophosphate + PE(24:0/24:1(15Z))details
CDP-Ethanolamine + DG(24:1(15Z)/24:1(15Z)/0:0) → Cytidine monophosphate + PE(24:1(15Z)/24:1(15Z))details
General function:
Cell wall/membrane/envelope biogenesis
Specific function:
Plays an important role in the biosynthesis of the phospholipid phosphatidylethanolamine. Catalyzes the formation of CDP-ethanolamine (By similarity).
Gene Name:
PCYT2
Uniprot ID:
Q5EA75
Molecular weight:
44158.0
Reactions
Cytidine triphosphate + O-Phosphoethanolamine → Pyrophosphate + CDP-Ethanolaminedetails