1.0 2016-09-30 22:49:09 UTC 2020-05-11 19:54:24 UTC BMDB0001959 BMDB01959 Gamma-Aminobutyryl-lysine g-Aminobutyryl-lysine Γ-aminobutyryl-lysine L-N2-(4-Aminobutyryl)-lysine N2-(4-Aminobutyryl)-lysine Na-(g-aminobutyryl)-L-lysine Na-(g-aminobutyryl)lysine Na-(gamma-aminobutyryl)-L-lysine Na-(gamma-aminobutyryl)lysine Nalpha-(g-aminobutyryl)-L-lysine Nalpha-(g-aminobutyryl)lysine Nalpha-(gamma-aminobutyryl)-L-lysine Nalpha-(gamma-aminobutyryl)lysine 6-Amino-2-[(4-amino-1-hydroxybutylidene)amino]hexanoate C10H21N3O3 231.292 231.158291553 6-amino-2-(4-aminobutanamido)hexanoic acid 6-amino-2-(4-aminobutanamido)hexanoic acid 22468-02-6 NCCCCC(NC(=O)CCCN)C(O)=O InChI=1S/C10H21N3O3/c11-6-2-1-4-8(10(15)16)13-9(14)5-3-7-12/h8H,1-7,11-12H2,(H,13,14)(H,15,16) OCBQYJFUZHJRIU-UHFFFAOYSA-N belongs to the class of organic compounds known as hybrid peptides. Hybrid peptides are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. Organic compounds Organic acids and derivatives Peptidomimetics Hybrid peptides Hybrid peptides Amino acids Amino fatty acids Carbonyl compounds Carboxylic acids Gamma amino acids and derivatives Hydrocarbon derivatives Medium-chain fatty acids Monoalkylamines Monocarboxylic acids and derivatives N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Alpha-amino acid or derivatives Amine Amino acid Amino acid or derivatives Amino fatty acid Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Fatty amide Gamma amino acid or derivatives Hybrid peptide Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide Aliphatic acyclic compounds Solid logp -3.28 ALOGPS logs -1.25 ALOGPS logp -3.8 ChemAxon pka_strongest_acidic 3.91 ChemAxon pka_strongest_basic 10.41 ChemAxon iupac 6-amino-2-(4-aminobutanamido)hexanoic acid ChemAxon average_mass 231.292 ChemAxon mono_mass 231.158291553 ChemAxon smiles NCCCCC(NC(=O)CCCN)C(O)=O ChemAxon formula C10H21N3O3 ChemAxon inchi InChI=1S/C10H21N3O3/c11-6-2-1-4-8(10(15)16)13-9(14)5-3-7-12/h8H,1-7,11-12H2,(H,13,14)(H,15,16) ChemAxon inchikey OCBQYJFUZHJRIU-UHFFFAOYSA-N ChemAxon polar_surface_area 118.44 ChemAxon refractivity 60.07 ChemAxon polarizability 25.48 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Specdb::CMs 14169 Specdb::CMs 38200 Specdb::MsMs 297244 Specdb::MsMs 297245 Specdb::MsMs 297246 Specdb::MsMs 338719 Specdb::MsMs 338720 Specdb::MsMs 338721 Brain Wishart DS, Feunang YD, Marcu A, Guo AC, Liang K, Vazquez-Fresno R, Sajed T, Johnson D, Li C, Karu N, Sayeeda Z, Lo E, Assempour N, Berjanskii M, Singhal S, Arndt D, Liang Y, Badran H, Grant J, Serra-Cayuela A, Liu Y, Mandal R, Neveu V, Pon A, Knox C, Wilson M, Manach C, Scalbert A: HMDB 4.0: the human metabolome database for 2018. Nucleic Acids Res. 2018 Jan 4;46(D1):D608-D617. doi: 10.1093/nar/gkx1089. 29140435 FDB022766 16267810 23208897 89308 6403