1.0 2016-09-30 23:04:52 UTC 2020-04-22 15:12:22 UTC BMDB0003470 BMDB03470 N-Formyl-L-glutamic acid N-Formyl-L-glutamic acid, also known as N-formyl-L-glutamate, belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. N-Formyl-L-glutamic acid is possibly soluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). N-Formyl-L-glutamic acid exists in all living organisms, ranging from bacteria to humans. Tetrahydrofolic acid and N-formyl-L-glutamic acid can be biosynthesized from N5-formyl-THF and L-glutamic acid; which is mediated by the enzyme formimidoyltransferase-cyclodeaminase. In cattle, N-formyl-L-glutamic acid is involved in the metabolic pathway called the folate metabolism pathway. (2S)-2-(Formylamino)pentanedioic acid N-Formyl-L-glutamate (2S)-2-(Formylamino)pentanedioate N-Formylglutamate, ion(2-) N-Formylglutamate (2S)-2-Formamidopentanedioate (2S)-2-Formamidopentanedioic acid C6H9NO5 175.1394 175.048072403 (2S)-2-formamidopentanedioic acid N-formyl-L-glutamic acid 1681-96-5 OC(=O)CC[C@H](NC=O)C(O)=O InChI=1S/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 ADZLWSMFHHHOBV-BYPYZUCNSA-N belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Glutamic acid and derivatives Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Hydrocarbon derivatives N-acyl-L-alpha-amino acids N-formyl-alpha amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Glutamic acid or derivatives Hydrocarbon derivative N-acyl-l-alpha-amino acid N-formyl-alpha amino acid or derivatives N-formyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Aliphatic acyclic compounds N-acyl-L-glutamic acid N-formyl amino acid Solid logp -0.86 ALOGPS logs -0.85 ALOGPS logp -1.2 ChemAxon pka_strongest_acidic 3.3 ChemAxon pka_strongest_basic -0.91 ChemAxon iupac (2S)-2-formamidopentanedioic acid ChemAxon average_mass 175.1394 ChemAxon mono_mass 175.048072403 ChemAxon smiles OC(=O)CC[C@H](NC=O)C(O)=O ChemAxon formula C6H9NO5 ChemAxon inchi InChI=1S/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 ChemAxon inchikey ADZLWSMFHHHOBV-BYPYZUCNSA-N ChemAxon polar_surface_area 103.7 ChemAxon refractivity 36.24 ChemAxon polarizability 15.42 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Folate Metabolism SMP0087196 Specdb::MsIr 1993 Specdb::MsIr 1994 Specdb::MsIr 1995 Specdb::CMs 17027 Specdb::CMs 38611 Specdb::CMs 175304 Specdb::MsMs 303691 Specdb::MsMs 303692 Specdb::MsMs 303693 Specdb::MsMs 346690 Specdb::MsMs 346691 Specdb::MsMs 346692 Specdb::MsMs 2797718 Specdb::MsMs 2797719 Specdb::MsMs 2797720 Specdb::MsMs 2880494 Specdb::MsMs 2880495 Specdb::MsMs 2880496 Specdb::NmrOneD 149560 Specdb::NmrOneD 149561 Specdb::NmrOneD 149562 Specdb::NmrOneD 149563 Specdb::NmrOneD 149564 Specdb::NmrOneD 149565 Specdb::NmrOneD 149566 Specdb::NmrOneD 149567 Specdb::NmrOneD 149568 Specdb::NmrOneD 149569 Specdb::NmrOneD 149570 Specdb::NmrOneD 149571 Specdb::NmrOneD 149572 Specdb::NmrOneD 149573 Specdb::NmrOneD 149574 Specdb::NmrOneD 149575 Specdb::NmrOneD 149576 Specdb::NmrOneD 149577 Specdb::NmrOneD 149578 Specdb::NmrOneD 149579 FDB023180 388496 C01045 439376 48309 6939 Borek, Blanche Ann; Waelsch, Heinrich. The enzymic degradation of histidine. Journal of Biological Chemistry (1953), 205 459-74.