1.0 2016-09-30 23:25:59 UTC 2020-05-21 16:28:41 UTC BMDB0006790 BMDB06790 Galactosylglycerol Galactosylglycerol, also known as galactosylglycerol, belongs to the class of organic compounds known as glycosylglycerols. These are glycerolipids structurally characterized by the presence of one or more sugar residues attached to glycerol via a glycosidic linkage. Galactosylglycerol is possibly soluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Galactosylglycerol exists in all living species, ranging from bacteria to humans. Galactosylglycerol can be biosynthesized from D-galactose and glycerol; which is catalyzed by the enzyme Alpha-galactosidase a. In cattle, galactosylglycerol is involved in the metabolic pathway called the galactose metabolism pathway. (2R,3R,4S,5R,6R)-2-[(2R)-2,3-Dihydroxypropoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 3-b-D-Galactosyl-sn-glycerol 3-beta-D-Galactosyl-sn-glycerol 3-beta-delta-Galactosyl-sn-glycerol Azepan-2-one C9H18O8 254.2344 254.100167552 (2R,3R,4S,5R,6R)-2-(2,3-dihydroxypropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol galactosylglycerol OCC(O)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O InChI=1S/C9H18O8/c10-1-4(12)3-16-9-8(15)7(14)6(13)5(2-11)17-9/h4-15H,1-3H2/t4?,5-,6+,7+,8-,9-/m1/s1 NHJUPBDCSOGIKX-VGPGGAHRSA-N belongs to the class of organic compounds known as glycosylglycerols. These are glycerolipids structurally characterized by the presence of one or more sugar residues attached to glycerol via a glycosidic linkage. Organic compounds Lipids and lipid-like molecules Glycerolipids Glycosylglycerols Glycosylglycerols Acetals Hydrocarbon derivatives Monosaccharides O-glycosyl compounds Oxacyclic compounds Oxanes Polyols Primary alcohols Secondary alcohols Acetal Alcohol Aliphatic heteromonocyclic compound Glycosyl compound Glycosylglycerol Hydrocarbon derivative Monosaccharide O-glycosyl compound Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxane Polyol Primary alcohol Secondary alcohol Aliphatic heteromonocyclic compounds Solid logp -2.80 ALOGPS logs 0.15 ALOGPS logp -3.6 ChemAxon pka_strongest_acidic 12.19 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2R,3R,4S,5R,6R)-2-(2,3-dihydroxypropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol ChemAxon average_mass 254.2344 ChemAxon mono_mass 254.100167552 ChemAxon smiles OCC(O)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O ChemAxon formula C9H18O8 ChemAxon inchi InChI=1S/C9H18O8/c10-1-4(12)3-16-9-8(15)7(14)6(13)5(2-11)17-9/h4-15H,1-3H2/t4?,5-,6+,7+,8-,9-/m1/s1 ChemAxon inchikey NHJUPBDCSOGIKX-VGPGGAHRSA-N ChemAxon polar_surface_area 139.84 ChemAxon refractivity 52.93 ChemAxon polarizability 24.27 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 6 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon number_of_rings 1 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Galactose Metabolism SMP0087225 Specdb::CMs 2347 Specdb::CMs 39087 Specdb::CMs 131626 Specdb::CMs 139360 Specdb::MsMs 182601 Specdb::MsMs 182602 Specdb::MsMs 182603 Specdb::MsMs 182949 Specdb::MsMs 182950 Specdb::MsMs 182951 Specdb::MsMs 2266719 Specdb::MsMs 2266720 Specdb::MsMs 2266721 Specdb::MsMs 3075672 Specdb::MsMs 3075673 Specdb::MsMs 3075674 Specdb::NmrOneD 91372 Specdb::NmrOneD 91373 Specdb::NmrOneD 91374 Specdb::NmrOneD 91375 Specdb::NmrOneD 91376 Specdb::NmrOneD 91377 Specdb::NmrOneD 91378 Specdb::NmrOneD 91379 Specdb::NmrOneD 91380 Specdb::NmrOneD 91381 Specdb::NmrOneD 91382 Specdb::NmrOneD 91383 Specdb::NmrOneD 91384 Specdb::NmrOneD 91385 Specdb::NmrOneD 91386 Specdb::NmrOneD 91387 Specdb::NmrOneD 91388 Specdb::NmrOneD 91389 Specdb::NmrOneD 91390 Specdb::NmrOneD 91391 FDB024079 570889 15754 656504 C05401 BMDBP02909 Alpha-N-acetylgalactosaminidase Q58DH9 NAGA Enzyme