1.0 2016-09-30 23:26:28 UTC 2020-05-21 16:28:32 UTC BMDB0006825 BMDB06825 Tetrahydrofolyl-[Glu](2) Tetrahydrofolyl-[glu](2), also known as tetrahydrofolyl-[glu](2) or (6S)-H4pteglu2, belongs to the class of organic compounds known as tetrahydrofolic acids and derivatives. These are heterocyclic compounds based on the 5,6,7,8-tetrahydropteroic acid skeleton conjugated with at least one L-glutamic acid unit (or a derivative thereof) . Tetrahydrofolyl-[glu](2) is possibly soluble (in water) and a strong basic compound (based on its pKa). Tetrahydrofolyl-[glu](2) exists in all living organisms, ranging from bacteria to humans. Tetrahydrofolyl-[glu](2) participates in a number of enzymatic reactions, within cattle. In particular, Tetrahydrofolyl-[glu](2) can be biosynthesized from tetrahydrofolic acid and L-glutamic acid; which is catalyzed by the enzyme folylpolyglutamate synthase. In addition, Tetrahydrofolyl-[glu](2) and L-glutamic acid can be converted into tetrahydrofolyl-[glu](N); which is catalyzed by the enzyme folylpolyglutamate synthase. In cattle, tetrahydrofolyl-[glu](2) is involved in the metabolic pathway called the folate metabolism pathway. Tetrahydropteroyldiglutamate (6S)-H4PteGlu2 Tetrahydropteroyldiglutamic acid Tetrahydrofolyl-[glu](n+1) Tetrahydropteroyl-[gamma-glu]N Tetrahydropteroyl-[gamma-glu]n+1 THF-L-Glutamate THF-L-Glutamic acid THF-Polyglutamate C24H30N8O9 574.5432 574.213574598 2-{4-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)formamido]-4-carboxybutanamido}pentanedioic acid 2-{4-[(4-{[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methyl]amino}phenyl)formamido]-4-carboxybutanamido}pentanedioic acid NC1=NC2=C(NC(CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)NC(CCC(O)=O)C(O)=O)C(O)=O)CN2)C(=O)N1 InChI=1S/C24H30N8O9/c25-24-31-19-18(21(37)32-24)28-13(10-27-19)9-26-12-3-1-11(2-4-12)20(36)30-15(23(40)41)5-7-16(33)29-14(22(38)39)6-8-17(34)35/h1-4,13-15,26,28H,5-10H2,(H,29,33)(H,30,36)(H,34,35)(H,38,39)(H,40,41)(H4,25,27,31,32,37) ZAOGJXDWOQXFBW-UHFFFAOYSA-N belongs to the class of organic compounds known as tetrahydrofolic acids and derivatives. These are heterocyclic compounds based on the 5,6,7,8-tetrahydropteroic acid skeleton conjugated with at least one L-glutamic acid unit (or a derivative thereof) . Organic compounds Organoheterocyclic compounds Pteridines and derivatives Pterins and derivatives Tetrahydrofolic acids and derivatives Amino acids Aminobenzamides Aminopyrimidines and derivatives Aniline and substituted anilines Azacyclic compounds Benzoyl derivatives Carbonyl compounds Carboxylic acids Dipeptides Gamma-glutamyl amino acids Glutamic acid and derivatives Glutamine and derivatives Heteroaromatic compounds Hippuric acids Hydrocarbon derivatives N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Phenylalkylamines Primary amines Pyrimidones Secondary alkylarylamines Secondary carboxylic acid amides Tricarboxylic acids and derivatives Vinylogous amides Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Aminobenzamide Aminobenzoic acid or derivatives Aminopyrimidine Aniline or substituted anilines Aromatic heteropolycyclic compound Azacycle Benzamide Benzenoid Benzoic acid or derivatives Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamic acid or derivatives Glutamine or derivatives Heteroaromatic compound Hippuric acid Hippuric acid or derivatives Hydrocarbon derivative Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalkylamine Primary amine Pyrimidine Pyrimidone Secondary aliphatic/aromatic amine Secondary amine Secondary carboxylic acid amide Tetrahydrofolic acid or derivatives Tricarboxylic acid or derivatives Vinylogous amide Aromatic heteropolycyclic compounds Solid logp -1.99 ALOGPS logs -3.24 ALOGPS logp -4.3 ChemAxon pka_strongest_acidic 2.41 ChemAxon pka_strongest_basic 4.66 ChemAxon iupac 2-{4-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)formamido]-4-carboxybutanamido}pentanedioic acid ChemAxon average_mass 574.5432 ChemAxon mono_mass 574.213574598 ChemAxon smiles NC1=NC2=C(NC(CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)NC(CCC(O)=O)C(O)=O)C(O)=O)CN2)C(=O)N1 ChemAxon formula C24H30N8O9 ChemAxon inchi InChI=1S/C24H30N8O9/c25-24-31-19-18(21(37)32-24)28-13(10-27-19)9-26-12-3-1-11(2-4-12)20(36)30-15(23(40)41)5-7-16(33)29-14(22(38)39)6-8-17(34)35/h1-4,13-15,26,28H,5-10H2,(H,29,33)(H,30,36)(H,34,35)(H,38,39)(H,40,41)(H4,25,27,31,32,37) ChemAxon inchikey ZAOGJXDWOQXFBW-UHFFFAOYSA-N ChemAxon polar_surface_area 273.67 ChemAxon refractivity 149.67 ChemAxon polarizability 57.11 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 14 ChemAxon donor_count 10 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon number_of_rings 3 ChemAxon bioavailability 0 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Folate Metabolism SMP0087196 Specdb::MsMs 26492 Specdb::MsMs 26493 Specdb::MsMs 26494 Specdb::MsMs 33050 Specdb::MsMs 33051 Specdb::MsMs 33052 Specdb::MsMs 2275053 Specdb::MsMs 2275054 Specdb::MsMs 2275055 Specdb::MsMs 3091181 Specdb::MsMs 3091182 Specdb::MsMs 3091183 Specdb::NmrOneD 91792 Specdb::NmrOneD 91793 Specdb::NmrOneD 91794 Specdb::NmrOneD 91795 Specdb::NmrOneD 91796 Specdb::NmrOneD 91797 Specdb::NmrOneD 91798 Specdb::NmrOneD 91799 Specdb::NmrOneD 91800 Specdb::NmrOneD 91801 Specdb::NmrOneD 91802 Specdb::NmrOneD 91803 Specdb::NmrOneD 91804 Specdb::NmrOneD 91805 Specdb::NmrOneD 91806 Specdb::NmrOneD 91807 Specdb::NmrOneD 91808 Specdb::NmrOneD 91809 Specdb::NmrOneD 91810 Specdb::NmrOneD 91811 Specdb::CMs 19505 Specdb::CMs 39106 Specdb::CMs 282408 Specdb::CMs 372794 Specdb::CMs 372795 Specdb::CMs 372796 Specdb::CMs 372797 Specdb::CMs 372798 Specdb::CMs 372799 Specdb::CMs 372800 Specdb::CMs 372801 Specdb::CMs 372802 Specdb::CMs 372803 Specdb::CMs 372804 Specdb::CMs 372805 Specdb::CMs 372806 Specdb::CMs 372807 Specdb::CMs 372808 Specdb::CMs 372809 Specdb::CMs 372810 Specdb::CMs 372811 Specdb::CMs 372812 Specdb::CMs 372813 Specdb::CMs 372814 Specdb::CMs 372815 FDB024105 390680 C09332 442163 28624 BMDBP00169 Folylpolyglutamate synthase, mitochondrial A6H751 FPGS Enzyme BMDBP02884 Gamma-glutamyl hydrolase A7YWG4 GGH Enzyme