1.0 2016-10-03 18:12:26 UTC 2020-05-21 16:28:22 UTC BMDB0010716 BMDB10716 Gamma-Glutamyl-Se-methylselenocysteine Gamma-Gamma-gamma-glutamyl-se-methylselenocysteine, also known as gamma-gamma-glutamyl-se-methylselenocysteine or GGMSC CPD, belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Gamma-Gamma-gamma-glutamyl-se-methylselenocysteine is possibly soluble (in water) and a very strong basic compound (based on its pKa). Gamma-Gamma-gamma-glutamyl-se-methylselenocysteine exists in all living organisms, ranging from bacteria to humans. Gamma-Gamma-gamma-glutamyl-se-methylselenocysteine can be biosynthesized from se-methylselenocysteine; which is catalyzed by the enzyme Gamma-glutamyltranspeptidase 1. In cattle, Gamma-gamma-glutamyl-se-methylselenocysteine is involved in the metabolic pathway called the selenoamino acid metabolism pathway. g-Glutamyl-se-methylselenocysteine Γ-glutamyl-se-methylselenocysteine 5-Glutamyl-se-methylselenocysteine gamma-Glutamyl-semc g-Glutamyl-semc Γ-glutamyl-semc GGMSC CPD Glutamyl-se-methylselenocysteine C9H16N2O5Se 311.19 312.02244346 2-amino-4-{[1-carboxy-2-(methylselanyl)ethyl]carbamoyl}butanoic acid 2-amino-4-{[1-carboxy-2-(methylselanyl)ethyl]carbamoyl}butanoic acid C[Se]CC(NC(=O)CCC(N)C(O)=O)C(O)=O InChI=1S/C9H16N2O5Se/c1-17-4-6(9(15)16)11-7(12)3-2-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16) IEFQLTYCECVOLL-UHFFFAOYSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Dipeptides Alpha amino acids Amino acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Gamma-glutamyl amino acids Glutamine and derivatives Hydrocarbon derivatives Monoalkylamines N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Selenoethers Aliphatic acyclic compound Alpha-amino acid Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamine or derivatives Hydrocarbon derivative N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organoselenium compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide Selenoether Aliphatic acyclic compounds Solid logp -3.14 ALOGPS logs -1.00 ALOGPS logp -4.5 ChemAxon pka_strongest_acidic 1.28 ChemAxon pka_strongest_basic 9.31 ChemAxon iupac 2-amino-4-{[1-carboxy-2-(methylselanyl)ethyl]carbamoyl}butanoic acid ChemAxon average_mass 311.19 ChemAxon mono_mass 312.02244346 ChemAxon smiles C[Se]CC(NC(=O)CCC(N)C(O)=O)C(O)=O ChemAxon formula C9H16N2O5Se ChemAxon inchi InChI=1S/C9H16N2O5Se/c1-17-4-6(9(15)16)11-7(12)3-2-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16) ChemAxon inchikey IEFQLTYCECVOLL-UHFFFAOYSA-N ChemAxon polar_surface_area 129.72 ChemAxon refractivity 66.28 ChemAxon polarizability 24.81 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Selenoamino Acid Metabolism SMP0087161 Specdb::CMs 10313 Specdb::CMs 39524 Specdb::CMs 147485 Specdb::MsMs 9023 Specdb::MsMs 9024 Specdb::MsMs 9025 Specdb::MsMs 15695 Specdb::MsMs 15696 Specdb::MsMs 15697 Specdb::MsMs 2732574 Specdb::MsMs 2732575 Specdb::MsMs 2732576 Specdb::MsMs 2976878 Specdb::MsMs 2976879 Specdb::MsMs 2976880 Specdb::NmrOneD 92512 Specdb::NmrOneD 92513 Specdb::NmrOneD 92514 Specdb::NmrOneD 92515 Specdb::NmrOneD 92516 Specdb::NmrOneD 92517 Specdb::NmrOneD 92518 Specdb::NmrOneD 92519 Specdb::NmrOneD 92520 Specdb::NmrOneD 92521 Specdb::NmrOneD 92522 Specdb::NmrOneD 92523 Specdb::NmrOneD 92524 Specdb::NmrOneD 92525 Specdb::NmrOneD 92526 Specdb::NmrOneD 92527 Specdb::NmrOneD 92528 Specdb::NmrOneD 92529 Specdb::NmrOneD 92530 Specdb::NmrOneD 92531 389629 440760 C05695 28776 FDB027866 BMDBP03180 Glutathione hydrolase 7 Q0V8L2 GGT7 Enzyme