1.0 2016-10-03 18:14:02 UTC 2020-04-22 15:43:04 UTC BMDB0011171 BMDB11171 L-gamma-glutamyl-L-leucine L-g-Glutamyl-L-leucine L-Γ-glutamyl-L-leucine gamma-Glu-leu gamma-Glutamyl-leucine, (D,L)-isomer gamma-Glutamyl-leucine 2-[(4-Amino-4-carboxy-1-hydroxybutylidene)amino]-4-methylpentanoate C11H20N2O5 260.2869 260.13722176 2-(4-amino-4-carboxybutanamido)-4-methylpentanoic acid 2-(4-amino-4-carboxybutanamido)-4-methylpentanoic acid CC(C)CC(NC(=O)CCC(N)C(O)=O)C(O)=O InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h6-8H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18) MYFMARDICOWMQP-UHFFFAOYSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Dipeptides Alpha amino acids Amino acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Gamma-glutamyl amino acids Glutamine and derivatives Hydrocarbon derivatives Leucine and derivatives Methyl-branched fatty acids Monoalkylamines N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Alpha-amino acid Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Branched fatty acid Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamine or derivatives Hydrocarbon derivative Leucine or derivatives Methyl-branched fatty acid N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide Aliphatic acyclic compounds Solid logp -2.60 ALOGPS logs -1.76 ALOGPS logp -2.5 ChemAxon pka_strongest_acidic 1.78 ChemAxon pka_strongest_basic 9.31 ChemAxon iupac 2-(4-amino-4-carboxybutanamido)-4-methylpentanoic acid ChemAxon average_mass 260.2869 ChemAxon mono_mass 260.13722176 ChemAxon smiles CC(C)CC(NC(=O)CCC(N)C(O)=O)C(O)=O ChemAxon formula C11H20N2O5 ChemAxon inchi InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h6-8H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18) ChemAxon inchikey MYFMARDICOWMQP-UHFFFAOYSA-N ChemAxon polar_surface_area 129.72 ChemAxon refractivity 62.26 ChemAxon polarizability 26.54 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Specdb::CMs 19140 Specdb::CMs 39581 Specdb::MsMs 308521 Specdb::MsMs 308522 Specdb::MsMs 308523 Specdb::MsMs 352726 Specdb::MsMs 352727 Specdb::MsMs 352728 4524287