1.0 2016-10-03 18:32:54 UTC 2020-04-22 15:48:38 UTC BMDB0012130 BMDB12130 (S)-2,3,4,5-Tetrahydropiperidine-2-carboxylate (S)-2,3,4,5-Tetrahydropiperidine-2-carboxylate, also known as (s)-2,3,4,5-tetrahydropiperidine-2-carboxylate or (s)-2,3,4,5-tetrahydropiperidine-2-carboxylate, belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof (S)-2,3,4,5-Tetrahydropiperidine-2-carboxylate is possibly soluble (in water) and a very strong basic compound (based on its pKa) (S)-2,3,4,5-Tetrahydropiperidine-2-carboxylate can be biosynthesized from L-pipecolic acid through the action of the enzyme peroxisomal sarcosine oxidase. In cattle, (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate is involved in the metabolic pathway called the lysine degradation pathway. 2,3,4,5-Tetrahydro-2-pyridinecarboxylic acid Delta(1)-Piperidine-6-carboxylic acid 2,3,4,5-Tetrahydro-2-pyridinecarboxylate delta(1)-Piperidine-6-carboxylate Δ(1)-piperidine-6-carboxylate Δ(1)-piperidine-6-carboxylic acid 1-Piperideine-6-carboxylic acid (S)-2,3,4,5-Tetrahydropiperidine-2-carboxylic acid 1,6-Didehydropiperidine-2-carboxylate 2,3,4,5- Tetrahydropyridine-2-carboxylate Delta1-Piperideine-6-carboxylate Delta6-Piperideine-2-carboxylate delta-1-Piperideine-6-carboxylate delta-1-Piperidine-6-carboxylic acid C6H9NO2 127.1412 127.063328537 2,3,4,5-tetrahydropyridine-2-carboxylic acid 2,3,4,5-tetrahydropyridine-2-carboxylic acid 3038-89-9 OC(=O)C1CCCC=N1 InChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h4-5H,1-3H2,(H,8,9) CSDPVAKVEWETFG-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Alpha amino acids and derivatives Azacyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Imines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Tetrahydropyridines Aliphatic heteromonocyclic compound Alpha-amino acid or derivatives Azacycle Carbonyl group Carboxylic acid Hydrocarbon derivative Hydropyridine Imine Monocarboxylic acid or derivatives Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound Tetrahydropyridine Aliphatic heteromonocyclic compounds monocarboxylic acid tetrahydropyridine Solid logp 0.36 ALOGPS logs -1.17 ALOGPS logp -1.8 ChemAxon pka_strongest_acidic 2 ChemAxon pka_strongest_basic 6.22 ChemAxon iupac 2,3,4,5-tetrahydropyridine-2-carboxylic acid ChemAxon average_mass 127.1412 ChemAxon mono_mass 127.063328537 ChemAxon smiles OC(=O)C1CCCC=N1 ChemAxon formula C6H9NO2 ChemAxon inchi InChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h4-5H,1-3H2,(H,8,9) ChemAxon inchikey CSDPVAKVEWETFG-UHFFFAOYSA-N ChemAxon polar_surface_area 49.66 ChemAxon refractivity 32 ChemAxon polarizability 12.7 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 1 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Lysine Degradation SMP0087203 Specdb::MsMs 306814 Specdb::MsMs 306815 Specdb::MsMs 306816 Specdb::MsMs 350584 Specdb::MsMs 350585 Specdb::MsMs 350586 Specdb::MsMs 437953 Specdb::MsMs 446354 Specdb::CMs 18413 Specdb::CMs 30197 Specdb::CMs 30300 Specdb::CMs 39821 Specdb::CMs 100006 Specdb::CMs 100007 Specdb::CMs 102528 Specdb::CMs 102529 Specdb::CMs 102530 Specdb::CMs 102531 FDB028794 144715 165067 49015